162 products were found matching "K12654"!
No results were found for the filter!
Stimulator of interferon genes protein (STING1), partial,...
Item number: CSB-YP023754HU1c7.1
Organism: Homo sapiens (Human). Source: Yeast. Expression Region: 135-379aa. Protein Length: Partial. Tag Info: C-terminal 6xHis-tagged. Target Protein Sequence: GLKGLAPAEI SAVCEKGNFN VAHGLAWSYY IGYLRLILPE LQARIRTYNQ HYNNLLRGAV SQRLYILLPL DCGVPDNLSM ADPNIRFLDK LPQQTGDHAG IKDRVYSNSI YELLENGQRA GTCVLEYATP LQTLFAMSQY...
| Keywords: | ERIS, hMITA, hSTING, Transmembrane protein 173, Mediator of IRF3 activation, Stimulator of interferon genes protein,... |
| Application: | Activity not tested |
| Expressed in: | Yeast |
| Origin: | human |
| MW: | 29.6 kD |
From 347.00€
*
C-176
Item number: LKT-C000076.100
C-176 is a covalent inhibitor of STING. SMILES: C1=CC(=CC=C1NC(=O)C2=CC=C(O2)[N+](=O)[O-])I
| Keywords: | STING Inhibitor C-176, C176, C 176, N-(4-iodophenyl)-5-nitrofuran-2-carboxamide |
| Application: | STING antagonist |
| CAS | 314054-00-7 |
| MW: | 358.09 D |
From 84.00€
*
C-178
Item number: LKT-C000078.100
C-178 is a STING inhibitor. SMILES: C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)NC(=O)C4=CC=C(O4)[N+](=O)[O-]
| Keywords: | C178, STING inhibitor C-178, 5-Nitro-furan-2-carboxylic acid dibenzofuran-3-ylamide,... |
| Application: | STING inhibitor |
| CAS | 329198-87-0 |
| MW: | 322.28 D |
From 84.00€
*
C170
Item number: LKT-C000170.100
C170 is a potent and covalent inhibitor of STING. SMILES: CCCCC1=CC=C(C=C1)NC(=O)C2=CC=C(O2)[N+](=O)[O-]
| Keywords: | STING-IN-2, STING Inhibitor C-170, N-(4-butylphenyl)-5-nitrofuran-2-carboxamide |
| Application: | STING inhibitor |
| CAS | 346691-38-1 |
| MW: | 288.3 D |
From 69.00€
*
C-171
Item number: LKT-C000171.100
C-171 is an inhibitor of STING. SMILES: CCCCCCC1=CC=C(C=C1)NC(=O)C2=CC=C(O2)[N+](=O)[O-]
| Keywords: | STING-IN-3, CS-0165833, N-(4-hexylphenyl)-5-nitrofuran-2-carboxamide |
| Application: | STING inhibitor |
| CAS | 2244881-69-2 |
| MW: | 316.36 D |
From 69.00€
*
Cridanimod
Item number: LKT-C691325.100
Cridanimod is a STING agonist in mouse cells but not human cells.9-Oxo-10(9H)-acridineacetic acid (CAS 38609-97-1). SMILES: C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2CC(=O)O
| Keywords: | 10-carboxymethyl-9-acridanone, CMA, 9-Oxo-10(9H)-acridineacetic acid, 9-Oxoacridine-10-acetic acid |
| Application: | STING agonist |
| CAS | 38609-97-1 |
| MW: | 253.26 D |
From 99.00€
*
H-151
Item number: LKT-H000051.100
SMILES: CCC1=CC=C(C=C1)NC(=O)NC2=CNC3=CC=CC=C32
| Keywords: | H151, N-(4-ethylphenyl)-N'-1H-indol-3-yl-urea, 1-(4-Ethylphenyl)-3-(1H-indol-3-yl) urea |
| Application: | STING antagonist |
| CAS | 941987-60-6 |
| MW: | 279.34 D |
From 99.00€
*
MSA-2
Item number: LKT-M721002.100
MSA-2 is an agonist of stimulator of interferon genes (STING). SMILES: COC1=C(C=C2C(=C1)C=C(S2)C(=O)CCC(=O)O)OC
| Keywords: | MSA2, 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
| Application: | STING agonist |
| CAS | 129425-81-6 |
| MW: | 294.32 D |
From 145.00€
*
SN-011
Item number: LKT-S520011.1
SN-011 is an inhibitor of STING. SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC3=CC(=C(C=C3)O)NS(=O)(=O)C4=CC=C(C=C4)F
| Keywords: | GUN35901, SN011, N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide |
| Application: | STING antagonist |
| CAS | 2249435-90-1 |
| MW: | 462.5 D |
From 69.00€
*
SR-717 Lithium Salt
Item number: LKT-S680017.100
SR-717 Lithium salt is a STING agonist. SMILES: [Li+].C1=CC(=NN=C1C(=O)NC2=CC(=C(C=C2C(=O)[O-])F)F)N3C=CN=C3
| Keywords: | SR717 Lithium, lithium,4,5-difluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
| Application: | STING agonist |
| CAS | 2375421-09-1 |
| MW: | 351.2 D |
From 99.00€
*
STING Agonist-1
Item number: LKT-S771337.100
STING Agonist-1 is an indirect activator of STING signaling. SMILES: C1C(=O)N(C2=C(S1)C=CC(=C2)C(=O)NCC3=CC=CO3)CC4=C(C=CC=C4Cl)F
| Keywords: | G10, 4-[(2-chloro-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
| Application: | Indirect activator of STING signaling |
| CAS | 702662-50-8 |
| MW: | 430.88 D |
From 99.00€
*
STING Agonist-12
Item number: LKT-S771339.1
STING Agonist-12 is an activator of STING. SMILES: CC1(C2=C(C=C(C=C2)C(=O)NCC3=C(C=C(C=C3F)F)F)N(C1=O)CC4=C(C=CC=C4Cl)F)C
| Keywords: | Compound 53, STING Agonist C53, GTPL11960,... |
| Application: | STING activator |
| CAS | 2259624-71-8 |
| MW: | 490.88 D |
From 99.00€
*