28 products were found matching "K11841"!

Description: Spautin-1 is a novel autophagy inhibitor, IM inhibited the growth of K562 cells with IC50 of 1.03 µM. In contrast, co-treatment with Spautin-1 increased IM-induced inhibition of cell viability with IC50 of 0.45 µM. Target: Apoptosis, DUB, Autophagy. Smiles: Fc1ccc(CNc2ncnc3ccc(F)cc23)cc1. References:...

0.5mg/ml if reconstituted with 0.2ml sterile DI water. Ubiquitin specific peptidase 10, also known as USP10, is an enzyme which in humans is encoded by the USP10 gene. Ubiquitin is a highly conserved protein that is covalently linked to other proteins to regulate their function and degradation. This gene encodes a...

Spautin-1 is an autophagy inhibitor, inducing cell death in human breast cancer Bcap-37 cells grown in glucose-free media (EC50 = ~1.25 µM). It does not significantly affect the viability of Bcap-37 cells grown in complete media. Spautin-1 promotes the degradation of Vps34 PI3K complex by inhibiting the...

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....

The USP10 Inhibitor Screening Assay Kit is a fluorogenic assay designed to measure the activity of the deubiquitinating (DUB) enzyme USP10 (Ubiquitin Specific Peptidase 10) for screening and profiling applications. The kit comes in a convenient 96-well format and contains enough purified recombinant human USP10...

Human USP10 (Ubiquitin-Specific Protease 10) or Ubiquitin C-terminal Hydrolase 10, GenBank Accession No. NM_005153, amino-acids 2-798(end) with an N-terminal FLAG-tag, MW=88 kDa, expressed in a baculovirus-infected Sf9 cell expression system.

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....

Ubiquitin is a highly conserved protein that is covalently linked to other proteins to regulate their function and degradation. This gene encodes a member of the ubiquitin-specific protease family of cysteine proteases. The enzyme specifically cleaves ubiquitin from ubiquitin-conjugated protein substrates. The...

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....