80 products were found matching "K09568"!
No results were found for the filter!
Thalidomide-O-amido-PEG-C2-NH2
Item number: TGM-T39427-100mg
Description: Thalidomide-O-amido-PEG-C2-NH2 is a synthesized conjugate formulation designed as an E3 ligase ligand-linker conjugate, incorporating a cereblon ligand based on Thalidomide and a linker component commonly used in PROTAC technology. Target: Others. Smiles:...
| Keywords: | Thalidomide-O-amido-PEG-C2-NH2 |
| Application: | Protac(R) reagent |
| CAS | 2022182-59-6 |
| MW: | 418.4 D |
Please request pricing for this article.
FKBP12 Protein, Human, Recombinant (His)
Item number: TGM-TMPY-00808-100ug
Description: FKBP12 Protein, Human, Recombinant (His) is expressed in E. coli expression system with His tag. The predicted molecular weight is 12.9 kDa and the accession number is P62942.
| Keywords: | FKBP-12, PKC12, FKBP12, FKBP1, FKBP-1A, PPIASE, FK506 binding protein 1A, PKCI2 |
| MW: | 12.9 kD |
295.00€
*
Tacrolimus-13C-d2
Item number: TGM-TMIH-0548-1mg
Description: Tacrolimus-13C-d2 is the 13C and deuterated compound of Tacrolimus. Smiles: [2H]\[13C]([2H])=C/C[C@@H]1\C=C(C)\C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@H](C)C[C@@H]2OC)C(=O)C(=O)N2CCCC[C@H]2C(=O)O[C@@H]([C@H](C)[C@@H](O)CC1=O)C(\C)=C\[C@@H]1CC[C@@H](O)[C@@H](C1)OC
| Application: | GC-MS, LC-MS, internal standard, immunosuppressant |
| CAS | 1356841-89-8 |
| MW: | 807.02 D |
824.00€
*
FKBP12 Protein, Mouse, Recombinant (His)
Item number: TGM-TMPY-01662-100ug
Description: FKBP12 Protein, Mouse, Recombinant (His) is expressed in E. coli expression system with His tag. The predicted molecular weight is 12.7 kDa and the accession number is P26883.
| Keywords: | FKBP12, Fkbp, FK506 binding protein 1A, Fkbp1 |
| MW: | 12.7 kD |
397.00€
*
AP20187
Item number: TGM-T14299-100mg
Description: AP20187 (B/B Homodimerizer) is a cell-permeable compound used to dimerize FK506-binding protein (FKBP) fusion proteins, thereby initiating biological signaling cascades, gene expression, or disrupting protein-protein interactions. Target: Others. Smiles:...
| Keywords: | B/B Homodimerizer |
| Application: | FKBP fusion protein chemical inducer of dimerization (CID) |
| CAS | 195514-80-8 |
| MW: | 1482.75 D |
From 397.00€
*
Shield-1
Item number: TGM-T13884-100mg
Description: Shield-1 is a specific, high-affinity and cell-permeant ligand of FK506-binding protein-12 (FKBP), and reverses the instability by binding to mutated FKBP (mtFKBP), allowing conditional expression of mtFKBP-fused proteins. Shield-1 can stabilize the entire fusion protein. Target: Others. Smiles:...
| Application: | Protein stabilizing ligand |
| CAS | 914805-33-7 |
| MW: | 748.9 D |
From 161.00€
*
FK-506
Item number: Cay10007965-5
FK-506 is a potent immunosuppressant in the same molecular class as cyclosporin A (Cay-12088) and rapamycin (Cay-13346). Its mechanism of action involves the formation of a high affinity complex (Ki = 0.2 nM) with FK-506 binding protein 12 (FKBP12). This complex then inhibits the activity of the...
| Keywords: | Tacrolimus,... |
| Application: | Immunosuppressant |
| CAS | 104987-11-3 |
| MW: | 804 D |
From 49.00€
*
Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A),...
Item number: CSB-EP008691HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 2-103aa. Protein Length: Partial. Tag Info: N-terminal GST-tagged. Target Protein Sequence: GVQVETISPG DGRTFPKRGQ TCVVHYTGML EDGKKFDSSR DRNKPFKFML GKQEVIRGWE EGVAQMSVGQ RAKLTISPDY AYGATGHPGI IPPHATLVFD VE. Purity: Greater than 90% as determined by...
| Keywords: | FKBP1, FKBP1A, FKBP-12, FKBP-1A, Rotamase, Calstabin-1, 12 kDa FKBP, PPIase FKBP1A, Immunophilin FKBP12, FK506-binding... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 38.2 kD |
From 219.00€
*
Anti-FKBP1A
Item number: CSB-PA02325A0Rb.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: FKBP1A. Antigen Species: Human
| Keywords: | Anti-FKBP1, Anti-FKBP1A, Anti-FKBP-12, Anti-FKBP-1A, Anti-Rotamase, Anti-Calstabin-1, Anti-12 kDa FKBP, Anti-PPIase... |
| Application: | ELISA, WB, IHC, IF |
| Host: | Rabbit |
| Species reactivity: | human |
From 167.00€
*
Tacrolimus
Item number: LKT-T0008.5
An immunosuppressant commonly used in transplant operations to prevent graft-versus-host disease.
| Keywords: | FK506, FK-506, fujimycin |
| Application: | Immunomodulator |
| CAS | 104987-11-3 |
| MW: | 804,02 D |
From 63.00€
*
Ascomycin
Item number: Cay11309-5
Ascomycin, produced by the fermentation of S. hygroscopicus subsp. ascomyceticus, is an ethyl analog of tacrolimus (FK-506) with potent immunosuppressant properties that prevents T-cell proliferation through initial binding to FK-506-binding protein 12 (FKBP12), an immunophilin that acts as the principal mediator of...
| Keywords: | Changchuanmycin, FK-520, FR900520, Immunomycin, L 683590,... |
| Application: | Immunosuppressant |
| CAS | 104987-12-4 |
| MW: | 792 D |
From 67.00€
*
Pimecrolimus
Item number: Cay13107-10
Pimecrolimus is a natural ascomycin macrolactam that binds to macrophilin-12 (FKBP-12) and inhibits calcineurin as well as prolyl isomerase (rotamase). Presumably through these actions, it blocks the activation of T cells by allogeneic dendritic cells (IC50 = 0.55 nM) without affecting dendritic cells. Moreover,...
| Keywords: | Elidel, SDZ-ASM 981,... |
| Application: | Calcineurin inhibitor |
| CAS | 137071-32-0 |
| MW: | 810.5 D |
From 36.00€
*