69 products were found matching "K06226"!
No results were found for the filter!
SAG
Item number: Cay11914-1
Smoothened agonist (SAG) is a chlorobenzothiophene-containing compound which acts as a SMO agonist (EC50 = 3 nM) but inhibits hedgehog signaling at high concentrations (>1 µM). It directly binds to SMO and can block SMO inhibition by cyclopamine. Binding of SAG alters the conformation of SMO, leading to its...
| Keywords: | Smoothened Agonist,... |
| Application: | Smo Agonist |
| CAS | 912545-86-9 |
| MW: | 490.1 D |
From 35.00€
*
Anti-SMO
Item number: CSB-PA288930GA01HU.100
Protein function: G protein-coupled receptor that probably associates with the patched protein (PTCH) to transduce the hedgehog's proteins signal. Binding of sonic hedgehog (SHH) to its receptor patched is thought to prevent normal inhibition by patched of smoothened (SMO). Required for the accumulation of KIF7,...
| Keywords: | Anti-SMO, Anti-SMOH, Anti-Protein Gx, Anti-Smoothened homolog, SMO Antibody |
| Application: | ELISA, WB |
| Species reactivity: | human |
533.00€
*
SAG 21k
Item number: TGM-T35559-100mg
Description: SAG 21k is an orally bioactive and potent Hedgehog signaling activator that crosses the blood-brain barrier for the study of cartilage regeneration. Target: Hedgehog/Smoothened. Smiles: ClC=1C=2C(SC1C(N(CC3=C(OC)C=CC(=C3)C=4C=CN=CC4)[C@H]5CC[C@H](NC)CC5)=O)=C(F)C=CC2F. References: Christopher Loose,et...
| Application: | Hedgehog signaling pathway agonist |
| CAS | 946002-48-8 |
| MW: | 556.07 D |
From 117.00€
*
Nat-20(S)-yne
Item number: TGM-T35562-10mg
Description: Smoothened (SMO) is a GPCR-like receptor which, with Patched, mediates hedgehog signaling to regulate gene expression through the Gli transcription factors. 20(S)-hydroxy Cholesterol (20(S)-OHC) is an oxysterol which binds SMO and activates hedgehog signaling (EC50 = 3 µM), and this activation is...
| Application: | Allosteric SMO activator |
| CAS | 1397692-46-4 |
| MW: | 370.57 D |
From 152.00€
*
PF-5274857 hydrochloride
Item number: TGM-T35563-50mg
Description: PF-5274857 hydrochloride is a potent, orally active, selective Smo antagonist (IC50=5.8 nM, Ki=4.6 nM) that is permeable through the blood-brain barrier. It has research potential in various tumors, including brain tumors and brain metastases driven by activated Hh pathways. Target: Others. Smiles:...
| Application: | SMO antagonist |
| CAS | 1613439-62-5 |
| MW: | 473.42 D |
2,402.00€
*
Patidegib HCl
Item number: TGM-T71338-100mg
Description: Patidegip, laos known as Saridegib and IPI-926, is an orally bioavailable, cyclopamine-derived (for structure comparison see Fig 1) inhibitor of the Hedgehog (Hh) pathway with potential antineoplastic activity. Specifically, Hedgehog pathway inhibitor IPI-926 binds to and inhibits the cell...
| Application: | Targets smoothened (SMO) |
| CAS | 1169829-40-6 |
| MW: | 541.23 D |
From 1,520.00€
*
Purmorphamine
Item number: TGM-T1810-10mg
Description: Purmorphamine (Shh Signaling Antagonist VI), which directly binds and activates Smoothened, blocks BODIPY-cyclopamine binding to Smo. It also is an inducer of osteoblast differentiation. Target: Smo, Autophagy, Hedgehog/Smoothened. Smiles: C1CCC(CC1)n1cnc2c(Nc3ccc(cc3)N3CCOCC3)nc(Oc3cccc4ccccc34)nc12....
| Keywords: | Shh Signaling Antagonist VI |
| Application: | Smo agonist |
| CAS | 483367-10-8 |
| MW: | 520.62 D |
From 52.00€
*
Sonidegib
Item number: TGM-T1926-100mg
Description: Sonidegib (Erismodegib), a Smoothened (Smo) antagonist, inhibits Hedgehog (Hh) signaling with IC50 of 1.3 nM (mouse) and 2.5 nM (human), respectively. Target: Smo, Hedgehog/Smoothened. Smiles: CC1=C(C=CC=C1C(NC=2C=CC(=NC2)N3C[C@@H](C)O[C@@H](C)C3)=O)C4=CC=C(OC(F)(F)F)C=C4. References: Pan SF, et al....
| Keywords: | Erismodegib, LDE225, NVP-LDE225 |
| Application: | Targets smoothened (SMO) |
| CAS | 956697-53-3 |
| MW: | 485.5 D |
From 55.00€
*
N-Palmitoyl-L-aspartate
Item number: TGM-T25918-100mg
Description: N-Palmitoyl-L-aspartate (L-N-Palmitoylaspartic acid) is a surfactant used in detergents and is commonly used in the skin care industry. Target: Others. Smiles: [C@H](NC(CCCCCCCCCC CCCCC)=O)(CC(O)=O)C(O)=O. References: Ballatore C, Huryn DM, Smith AB 3rd. Carboxylic acid (bio)isosteres in drug design....
| Keywords: | L-N-Palmitoylaspartic acid, Palmitoyl-L-aspartic acid, N-Palmitoyl aspartic acid |
| Application: | Hedgehog signaling inhibitor |
| CAS | 1782-17-8 |
| MW: | 371.51 D |
From 94.00€
*
SAG
Item number: TGM-T1779-100mg
Description: SAG (Smoothened Agonist) is a Smo receptor agonist (EC50=3 nM) that is cell-permeable and selective. SAG regulates Smo activity by binding directly to the Smo helix and can activate the Hedgehog signaling pathway. Target: Smo, Hedgehog/Smoothened. Smiles:...
| Keywords: | Smoothened Agonist (SAG) HCl, Smoothened Agonist |
| Application: | Smo Agonist |
| CAS | 912545-86-9 |
| MW: | 490.06 D |
From 46.00€
*
ALLO-1
Item number: TGM-T19188-10mg
Description: ALLO-1 is a crucial autophagy receptor responsible for facilitating the formation of autophagosomes around paternal organelles. It directly interacts with the worm LC3 homologue, LGG-1, through its LC3-interacting region (LIR) motif. Target: Autophagy. Smiles: CC1N(Cc2ccccc2)C(=O)N(C1=O)c1ccc(Cl)cc1....
| Application: | SMO antagonist |
| CAS | 37468-32-9 |
| MW: | 314.77 D |
From 243.00€
*
Glasdegib
Item number: TGM-T6514-100mg
Description: Glasdegib (PF-04449913) (PF-04449913) is a potent, and orally bioavailable Smoothened (Smo) inhibitor with IC50 of 5 nM. Phase 2. Target: Smo, Hedgehog/Smoothened. Smiles: CN1CC[C@H](C[C@@H]1c1nc2ccccc2[nH]1)NC(=O)Nc1ccc(cc1)C#N. References: Munchhof MJ, et al. ACS Med Chem Lett. 2011, 3(2), 106-111.
| Keywords: | PF-04449913 |
| Application: | Targets smoothened (SMO) |
| CAS | 1095173-27-5 |
| MW: | 374.44 D |
From 37.00€
*