67 products were found matching "K06226"!
No results were found for the filter!
SAG
Item number: Cay11914-1
Smoothened agonist (SAG) is a chlorobenzothiophene-containing compound which acts as a SMO agonist (EC50 = 3 nM) but inhibits hedgehog signaling at high concentrations (>1 µM). It directly binds to SMO and can block SMO inhibition by cyclopamine. Binding of SAG alters the conformation of SMO, leading to its...
| Keywords: | Smoothened Agonist,... |
| Application: | Smo Agonist |
| CAS | 912545-86-9 |
| MW: | 490.1 D |
From 34.00€
*
SAG 21k
Item number: TGM-T35559-100mg
Description: SAG 21k is an orally bioactive and potent Hedgehog signaling activator that crosses the blood-brain barrier for the study of cartilage regeneration. Target: Hedgehog/Smoothened. Smiles: ClC=1C=2C(SC1C(N(CC3=C(OC)C=CC(=C3)C=4C=CN=CC4)[C@H]5CC[C@H](NC)CC5)=O)=C(F)C=CC2F. References: Christopher Loose,et...
| Application: | Hedgehog signaling pathway agonist |
| CAS | 946002-48-8 |
| MW: | 556.07 D |
From 114.00€
*
Nat-20(S)-yne
Item number: TGM-T35562-10mg
Description: Smoothened (SMO) is a GPCR-like receptor which, with Patched, mediates hedgehog signaling to regulate gene expression through the Gli transcription factors. 20(S)-hydroxy Cholesterol (20(S)-OHC) is an oxysterol which binds SMO and activates hedgehog signaling (EC50 = 3 µM), and this activation is...
| Application: | Allosteric SMO activator |
| CAS | 1397692-46-4 |
| MW: | 370.57 D |
From 149.00€
*
PF-5274857 hydrochloride
Item number: TGM-T35563-50mg
Description: PF-5274857 hydrochloride is a potent, orally active, selective Smo antagonist (IC50=5.8 nM, Ki=4.6 nM) that is permeable through the blood-brain barrier. It has research potential in various tumors, including brain tumors and brain metastases driven by activated Hh pathways. Target: Others. Smiles:...
| Application: | SMO antagonist |
| CAS | 1613439-62-5 |
| MW: | 473.42 D |
2,355.00€
*
Taladegib
Item number: TGM-T2666-1mg
Description: Taladegib (LY2940680) is an orally bioavailable small molecule antagonist of the Hedgehog (Hh)-ligand cell surface receptor smoothened (Smo) with potential antineoplastic activity. Target: Smo, Hedgehog/Smoothened. Smiles: CN(C1CCN(CC1)c1nnc(-c2ccnn2C)c2ccccc12)C(=O)c1ccc(F)cc1C(F)(F)F. References:...
| Keywords: | LY2940680 |
| Application: | Targets smoothened (SMO) |
| CAS | 1258861-20-9 |
| MW: | 512.5 D |
From 41.00€
*
MK-4101
Item number: TGM-T6891-100mg
Description: MK-4101, an effective inhibitor of the Hedgehog pathway, has anti-tumor activity through the induction of extensive apoptosis and inhibition of proliferation in tumor cells. Target: Apoptosis, Smo, Hedgehog/Smoothened. Smiles: Cn1c(nnc1C12CCC(CC1)(CC2)c1noc(n1)C1CC(F)(F)C1)-c1ccccc1C(F)(F)F....
| Application: | Smoothened receptor antagonist |
| CAS | 935273-79-3 |
| MW: | 493.47 D |
From 39.00€
*
Patidegib HCl
Item number: TGM-T71338-100mg
Description: Patidegip, laos known as Saridegib and IPI-926, is an orally bioavailable, cyclopamine-derived (for structure comparison see Fig 1) inhibitor of the Hedgehog (Hh) pathway with potential antineoplastic activity. Specifically, Hedgehog pathway inhibitor IPI-926 binds to and inhibits the cell...
| Application: | Targets smoothened (SMO) |
| CAS | 1169829-40-6 |
| MW: | 541.23 D |
From 1,491.00€
*
Purmorphamine
Item number: TGM-T1810-10mg
Description: Purmorphamine (Shh Signaling Antagonist VI), which directly binds and activates Smoothened, blocks BODIPY-cyclopamine binding to Smo. It also is an inducer of osteoblast differentiation. Target: Smo, Autophagy, Hedgehog/Smoothened. Smiles: C1CCC(CC1)n1cnc2c(Nc3ccc(cc3)N3CCOCC3)nc(Oc3cccc4ccccc34)nc12....
| Keywords: | Shh Signaling Antagonist VI |
| Application: | Smo agonist |
| CAS | 483367-10-8 |
| MW: | 520.62 D |
From 51.00€
*
N-Palmitoyl-L-aspartate
Item number: TGM-T25918-100mg
Description: N-Palmitoyl-L-aspartate (L-N-Palmitoylaspartic acid) is a surfactant used in detergents and is commonly used in the skin care industry. Target: Others. Smiles: [C@H](NC(CCCCCCCCCC CCCCC)=O)(CC(O)=O)C(O)=O. References: Ballatore C, Huryn DM, Smith AB 3rd. Carboxylic acid (bio)isosteres in drug design....
| Keywords: | L-N-Palmitoylaspartic acid, Palmitoyl-L-aspartic acid, N-Palmitoyl aspartic acid |
| Application: | Hedgehog signaling inhibitor |
| CAS | 1782-17-8 |
| MW: | 371.51 D |
From 93.00€
*
SAG
Item number: TGM-T1779-100mg
Description: SAG (Smoothened Agonist) is a Smo receptor agonist (EC50=3 nM) that is cell-permeable and selective. SAG regulates Smo activity by binding directly to the Smo helix and can activate the Hedgehog signaling pathway. Target: Smo, Hedgehog/Smoothened. Smiles:...
| Keywords: | Smoothened Agonist (SAG) HCl, Smoothened Agonist |
| Application: | Smo Agonist |
| CAS | 912545-86-9 |
| MW: | 490.06 D |
From 47.00€
*
ALLO-1
Item number: TGM-T19188-10mg
Description: ALLO-1 is a crucial autophagy receptor responsible for facilitating the formation of autophagosomes around paternal organelles. It directly interacts with the worm LC3 homologue, LGG-1, through its LC3-interacting region (LIR) motif. Target: Autophagy. Smiles: CC1N(Cc2ccccc2)C(=O)N(C1=O)c1ccc(Cl)cc1....
| Application: | SMO antagonist |
| CAS | 37468-32-9 |
| MW: | 314.77 D |
From 239.00€
*
SAG 21k
Item number: Cay41121-10
SAG 21k is an agonist of the hedgehog signaling pathway. It activates the Smoothened receptor (Smo) in a reporter assay using C3H/10T1/2 cells expressing Smo (EC50 = 0.3 nM). SAG 21k (1 nM) increases the levels of mRNA encoding Ki67, coiled-coil domain-containing protein 1 (Ccdc1), collagen II, alkaline phosphatase...
| Keywords: | 3-chloro-4,7-difluoro-N-[[2-methoxy-5-(4-pyridinyl)phenyl]methyl]-N-[trans-4-(methylamino)cyclohexyl]-benzo[b]thiophene-2-... |
| Application: | Hedgehog signaling pathway agonist |
| CAS | 946002-48-8 |
| MW: | 556.1 D |
From 234.00€
*