140 products were found matching "K04802"!
No results were found for the filter!
PCNA antibody
Item number: ABS-KC-800.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Keywords: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA antibody |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-PCNA
Item number: ABS-KC-801.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Keywords: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-PCNA
Item number: ABS-KC-802.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Keywords: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-PCNA
Item number: ABS-OC-096.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Keywords: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-PCNA, clone 9C6
Item number: E-AN005350L.100
Auxiliary protein of DNA polymerase delta and epsilon, is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'-phosphodiesterase, but not apurinic-apyrimidinic...
| Keywords: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, PCNA Monoclonal Antibody |
| Application: | WB, IP, IHC |
| Host: | Mouse |
| Species reactivity: | human,mouse,rat |
From 61.00€
*
Anti-HRP-conjugated PCNA, clone 9C6
Item number: E-AN00472HP.100
Auxiliary protein of DNA polymerase delta and epsilon, is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'-phosphodiesterase, but not apurinic-apyrimidinic...
| Keywords: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, HRP-conjugated PCNA Monoclonal Antibody |
| Application: | WB |
| Host: | Mouse |
| Species reactivity: | human,mouse,rat |
From 73.00€
*
AOH1996
Item number: TGM-T77520-100mg
Description: AOH1996 is an orally active ligand for the replicasome component PCNA (proliferating cell nuclear antigen), targeting the transcription-replication conflict (TRC). It interferes with the interaction of PCNA with its binding proteins, leading to DNA replication stress and apoptosis. AOH1996 causes...
| Application: | PCNA inhibitor |
| CAS | 2089314-64-5 |
| MW: | 426.46 D |
From 60.00€
*
T2AA hydrochloride
Item number: TGM-T85298-10mg
Description: T2AA, a proliferating cell nuclear antigen (PCNA) inhibitor, disrupts protein-protein interactions between PCNA and both a PIP-box-containing peptide (IC50= 1 µM) and full-length p21, reducing cellular colocalization of PCNA with DNA polymerase delta. This compound effectively inhibits DNA replication...
| Keywords: | T2-amino Alcohol |
| Application: | PCNA/ PIP-Box interaction inhibitor |
| CAS | 2138331-07-2 |
| MW: | 547.6 D |
Please request pricing for this article.
PCNA-I1
Item number: TGM-T8955-100mg
Description: PCNA-I1 is an inhibitor targeting PCNA chromatin association in prostate cancer. Target: Others. Smiles: Cc1ccsc1C(=O)N\N=C\c1ccc2ccccc2c1O. References: Dillehay K L , Lu S , Dong Z . Antitumor Effects of a Novel Small Molecule Targeting PCNA Chromatin Association in Prostate Cancer[J]. Molecular Cancer...
| Application: | PCNA chromatin association inhibitor |
| CAS | 444930-42-1 |
| MW: | 310.37 D |
From 81.00€
*
PCNA Protein, Human, Recombinant (His)
Item number: TGM-TMPY-02543-100ug
Description: Proliferating Cell Nuclear Antigen (PCNA) is a protein only expressed in normal proliferate cells and cancer cells. It is central to both DNA replication and repair. One of the well-established functions for PCNA is its role as the processivity factor for DNA polymerase delta and epsilon. PCNA tethers...
| Keywords: | ATLD2, proliferating cell nuclear antigen |
| MW: | 31 kD |
699.00€
*
Proliferating cell nuclear antigen (PCNA), human,...
Item number: CSB-EP017621HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 1-261aa. Protein Length: Full Length. Tag Info: N-terminal 6xHis-tagged. Target Protein Sequence: MFEARLVQGS ILKKVLEALK DLINEACWDI SSSGVNLQSM DSSHVSLVQL TLRSEGFDTY RCDRNLAMGV NLTSMSKILK CAGNEDIITL RAEDNADTLA LVFEAPNQEK VSDYEMKLMD LDVEQLGIPE...
| Keywords: | PCNA, Cyclin, Proliferating cell nuclear antigen, Recombinant Human Proliferating cell nuclear antigen (PCNA) |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 32.8 kD |
From 219.00€
*
Proliferating cell nuclear antigen (POL30), Saccharomyces...
Item number: CSB-EP017621SVG.1
Organism: Saccharomyces cerevisiae (strain ATCC 204508 / S288c) (Baker's yeast). Source: E.coli. Expression Region: 1-258aa. Protein Length: Full Length. Tag Info: N-terminal 6xHis-SUMO-tagged. Target Protein Sequence: MLEAKFEEAS LFKRIIDGFK DCVQLVNFQC KEDGIIAQAV DDSRVLLVSL EIGVEAFQEY RCDHPVTLGM DLTSLSKILR CGNNTDTLTL...
| Keywords: | PCNA, POL30, YBR088C, YBR0811, Proliferating cell nuclear antigen, Recombinant Saccharomyces cerevisiae Proliferating cell... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | Saccharomyces cerevisiae |
| MW: | 44.9 kD |
From 364.00€
*