24 products were found matching "K04282"!
No results were found for the filter!
Montirelin
Item number: TGM-T33480-25mg
Description: Montirelin is an analog of thyrotropin-releasing hormone. Target: Others. Smiles: C([C@H](CC1=CN=CN1)NC(=O)[C@H]2NC(=O)[C@@H](C)SC2)(=O)N3[C@H](C(N)=O)CCC3. References: Fujisawa H, Nishimura T, Kimura K. [Antigenicity study on montirelin hydrate (NS-3)]. J Toxicol Sci. 1995 Dec,20 Suppl 2:341-8....
| Keywords: | CNK-603, CNK 602A, NS 3, Montirelinum |
| Application: | Targets thyrotropin-releasing hormone receptor (TRHR) |
| CAS | 90243-66-6 |
| MW: | 408.48 D |
1,491.00€
*
Human TRHR Protein, hFc Tag
Item number: DIM-PME101514.10
Recombinant human TRHR Protein with C-terminal human Fc tag. TRHR(Met1-Gln25) hFc(Glu99-Ala330), Protein function: Receptor for thyrotropin-releasing hormone (TRH). Upon ligand binding, this G-protein-coupled receptor triggers activation of the phosphatidylinositol (IP3)-calcium-protein kinase C (PKC) pathway. [The...
| Keywords: | CHNG7, TRH-R |
| Expressed in: | Human cells |
| Origin: | human |
| CAS | 12 |
| MW: | 29.0 kD |
From 126.00€
*
Anti-TRH Receptor
Item number: NSJ-N1066-100UG
0.5 mg/ml with 0.1 mg/ml BSA (US sourced), 0.05% sodium azide. Thyrotropin-releasing hormone (TRH) is produced by tissues of the nervous system and to a lesser degree, pancreas, testis, adrenal gland and lymphoid organs. There are two types of TRH in rodents, TRH1 and 2, but only TRH1 in humans. In cells of the...
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, TRH Receptor Antibody |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
From 317.00€
*
Thyrotropin-Releasing Hormone
Item number: Cay22917-10
Thyrotropin-releasing Hormone (TRH) is a tropic hormone that stimulates release of thyroid-stimulating hormone (TSH) and prolactin. It binds to the human TRH receptor (TRHR) expressed in CHO cells and to rat TRHR in rat brain membranes (IC50s = 25 and 198 nM, respectively). TRH (1 µM) decreases polyphosphoinositide...
| Keywords: | pGlu-His-Pro amide, Thyroliberin, Thyrotropin-Releasing Factor, TRF, TRH, TSH-releasing Hormone,... |
| Application: | TRHR agonist |
| CAS | 24305-27-9 |
| MW: | 362.4 D |
From 44.00€
*
Anti-TRH-R
Item number: ABE-11-8021-25
TRH-R (Thyrotropin-releasing hormone (TRH) receptors are Gq/11-protein-coupled receptors) is a member of G-protein coupled receptor 1 family. This is a thyrotropin-releasing hormone receptor. When it binds to TRH, it activates the inositol phospholipid-calcium-protein kinase C transduction pathway. TRH-R also...
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Polyclonal Antibody to TRH-R |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
134.00€
*
-30 %
Discount Promotion
Anti-TRH Receptor
Item number: ARG59728.100
Protein function: Receptor for thyrotropin-releasing hormone. This receptor is mediated by G proteins which activate a phosphatidylinositol-calcium second messenger system. [The UniProt Consortium]
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
584.00€
*
408.80€
*
Anti-TRH-R
Item number: ABE-11-8021-100
TRH-R (Thyrotropin-releasing hormone (TRH) receptors are Gq/11-protein-coupled receptors) is a member of G-protein coupled receptor 1 family. This is a thyrotropin-releasing hormone receptor. When it binds to TRH, it activates the inositol phospholipid-calcium-protein kinase C transduction pathway. TRH-R also...
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Polyclonal Antibody to TRH-R |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
387.00€
*
Anti-TRHR
Item number: ATA-HPA055162.100
Protein function: Receptor for thyrotropin-releasing hormone (TRH). Upon ligand binding, this G-protein-coupled receptor triggers activation of the phosphatidylinositol (IP3)-calcium-protein kinase C (PKC) pathway. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as...
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor |
| Application: | IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 335.00€
*
NEW
Anti-TRHR
Item number: CSB-PA024441LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Application: | ELISA, IF |
| Host: | Rabbit |
| Species reactivity: | human |
From 163.00€
*
NEW
Anti-TRHR, HRP conjugated
Item number: CSB-PA024441LB01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Application: | ELISA |
| Host: | Rabbit |
| Species reactivity: | human |
From 163.00€
*
NEW
Anti-TRHR, Biotin conjugated
Item number: CSB-PA024441LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Application: | ELISA |
| Host: | Rabbit |
| Species reactivity: | human |
From 163.00€
*
NEW
Anti-TRHR, FITC conjugated
Item number: CSB-PA024441LC01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Keywords: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Host: | Rabbit |
| Species reactivity: | human |
From 163.00€
*