99 products were found matching "K01528"!
No results were found for the filter!
Anti-DNM1
Item number: ABS-KC-1199.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Application: | IP |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 206.00€
*
Anti-DNM1
Item number: ABS-KC-1204.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 232.00€
*
Anti-DNM1
Item number: ABS-KC-1264.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 232.00€
*
Anti-DNM1
Item number: ABS-KC-1265.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 232.00€
*
Anti-DNM1
Item number: ABS-KC-1266.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 232.00€
*
Anti-DNM1
Item number: ABS-KC-1524.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 232.00€
*
Anti-DNM1
Item number: ABS-KC-1525.100
Protein function: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. [The UniProt Consortium]
| Keywords: | Anti-Dynamin-1, DNM1 Antibody |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human, mouse |
From 206.00€
*
Dynasore
Item number: Cay14062-5
Dynasore is a cell-permeable, reversible inhibitor of dynamin 1, dynamin 2, and mitochondrial dynamin, Drp1 GTPase activity (IC50 = 15 µM). Through this action, dynasore inhibits clathrin-dependent vesicle formation and endocytosis, which is necessary for internalization of certain parasites and viruses, as well as...
| Keywords: | 3-hydroxy-2-[(3,4-dihydroxyphenyl)methylene]hydrazide-2-naphthalenecarboxylic acid |
| Application: | Dynamin inhibitor |
| CAS | 304448-55-3 |
| MW: | 322.3 D |
From 66.00€
*
Hydroxy-Dynasore
Item number: TGM-T6822-100mg
Description: Hydroxy-Dynasore (Dyngo-4a) , a effective dynamin inhibitor, inhibits withDynI (brain), DynI (rec), and DynII (rec) of IC50 of 0.38 µM, 1.1 µM, and 2.3 µM, respectively. Target: Dynamin. Smiles: Oc1cc(O)c(\C=N\NC(=O)c2cc3ccccc3cc2O)cc1O. References: McCluskey A, et al. Traffic. 2013, 14(12), 1272-1289.
| Keywords: | Dyngo-4a |
| Application: | Dynamin inhibitor |
| CAS | 1256493-34-1 |
| MW: | 338.31 D |
From 46.00€
*
DNM1 Protein, Human, Recombinant (His)
Item number: TGM-TMPH-01254-100ug
Description: Microtubule-associated force-producing protein involved in producing microtubule bundles and able to bind and hydrolyze GTP. Most probably involved in vesicular trafficking processes. Involved in receptor-mediated endocytosis. DNM1 Protein, Human, Recombinant (His) is expressed in E. coli expression...
| Keywords: | DNM, Dynamin, Dynamin I, Dynamin-1, DNM1 |
| MW: | 32.2 kD |
From 198.00€
*
Mdivi-1
Item number: TGM-T1907-100mg
Description: Mdivi-1 (Mitochondrial division inhibitor 1) is a mitochondrial division inhibitor that inhibits DRP1 and Dynamin I (IC50=1-10 µM). Mdivi-1 inhibits mitochondrial autophagy. Target: Mitophagy, Autophagy, Apoptosis, Dynamin. Smiles: O=C1N(C(=S)NC=2C1=CC=CC2)C3=CC(OC)=C(Cl)C=C3Cl. References: Fang CT,...
| Keywords: | Mitochondrial division inhibitor 1 |
| Application: | Mitochondrial division inhibitor, dynamin inhibitor |
| CAS | 338967-87-6 |
| MW: | 353.22 D |
From 40.00€
*
Dynasore
Item number: TGM-T1848-100mg
Description: Dynasore (Dynamin Inhibitor I), a cell-permeable chemical, can reversibly and non-competitivity inhibit GTPase activity of dynamin 1/2 (IC50: 15 µM in a cell-free assay). It also inhibits the mitochondrial dynamin Drp1, with no effect against other small GTPase. Target: Dynamin, HSV, Autophagy, Virus...
| Keywords: | Dynamin Inhibitor I |
| Application: | Dynamin GTPase inhibitor |
| CAS | 304448-55-3 |
| MW: | 322.31 D |
From 45.00€
*