118 products were found matching "K01363"!
No results were found for the filter!
Magic Red(TM) Cathepsin B Assay Kit
Item number: ICT-937
This kit is based on a cell-permeant fluorescent probe (MR-(RR)2) designed for real-time detection of cathepsin B activity within whole living cells, using a fluorescence microscope. Excitation wavelength 560nm, emission 610-650nm.
| Application: | Real time FM, FC |
305.00€
*
Anti-Cathepsin B (Capture/Detector)
Item number: E-AN003800P.1
Cathepsin B is a papain-family cysteine protease that is normally located in lysosomes, where it is involved in the turnover of proteins and plays various roles in maintaining the normal metabolism of cells. This protease has been implicated in pathological conditions, e.g., tumor progression and arthritis. In...
| Keywords: | Anti-Ctsb, Cathepsin B Polyclonal Antibody(Capture/Detector) |
| Application: | ELISA Capture/Detector |
| Host: | Rabbit |
| Species reactivity: | mouse,rat |
From 158.00€
*
Anti-CTSB
Item number: E-D-AB-10435L.100
The protein encoded by this gene is a lysosomal cysteine proteinase composed of a dimer of disulfide-linked heavy and light chains,both produced from a single protein precursor. It is also known as amyloid precursor protein secretase and is involved in the proteolytic processing of amyloid precursor protein (APP)....
| Keywords: | Anti-CTSB, Anti-CPSB, CTSB Polyclonal Antibody |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
From 109.00€
*
Magic Red(TM) Cathepsin B Assay Kit
Item number: ICT-938
This kit is based on a cell-permeant fluorescent probe (MR-(RR)2) designed for real-time detection of cathepsin B activity within whole living cells, using a fluorescence microscope. Excitation wavelength 560nm, emission 610-650nm.
| Application: | Real time FM, FC |
804.00€
*
Cathepsin B Protein, Human, Recombinant (GST)
Item number: TGM-TMPH-01059-100ug
Description: Thiol protease which is believed to participate in intracellular degradation and turnover of proteins. Cleaves matrix extracellular phosphoglycoprotein MEPE. Involved in the solubilization of cross-linked TG/thyroglobulin in the thyroid follicle lumen. Has also been implicated in tumor invasion and...
| Keywords: | CPSB, APP secretase, CTSB, APPS, Cathepsin B, Cathepsin B1 |
| MW: | 54.6 kD |
From 198.00€
*
Cathepsin B Protein, Human, Recombinant (His)
Item number: TGM-TMPY-00731-100ug
Description: Cathepsin B Protein, Human, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 37.2 kDa and the accession number is A0A024R374.
| Keywords: | CPSB, cathepsin B, APPS |
| MW: | 37.2 kD |
From 266.00€
*
Cathepsin B Protein, Mouse, Recombinant (His)
Item number: TGM-TMPY-02144-50ug
Description: Cathepsin B Protein, Mouse, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 36.6 kDa and the accession number is P10605.
| Keywords: | cathepsin B, CB |
| MW: | 36.6 kD |
599.00€
*
Cathepsin B Protein, Rat, Recombinant (His)
Item number: TGM-TMPY-04503-50ug
Description: Cathepsin B Protein, Rat, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 37.1 kDa and the accession number is F7FAT8.
| Keywords: | cathepsin B |
| MW: | 37.1 kD |
699.00€
*
Cathepsin Inhibitor 1
Item number: TGM-T6015-100mg
Description: Cathepsin Inhibitor 1 is an inhibitor of Cathepsin (L, L2, S, K, B) with pIC50 of 7.9, 6.7, 6.0, 5.5 and 5.2, respectively. Target: Cysteine Protease. Smiles: Cn1nc(cc1C(=O)NC(Cc1cccc(Cl)c1)C(=O)NCC#N)C(C)(C)C. References: Asaad N, et al. Bioorg Med Chem Lett, 2009, 19(15), 4280-4283.
| Application: | Cathepsin inhibitor |
| CAS | 225120-65-0 |
| MW: | 401.89 D |
From 42.00€
*
Anti-Cathepsin B (Capture/Detector)
Item number: E-AN000530P.1
CTSB(Cathepsin B) is also named as CPSB and belongs to the peptidase C1 family. It participates in intracellular degradation and turnover of proteins. Cathepsin B precursors found in human malignant ascites fluid do not possess mannose-rich carbohydrates suggesting that a defect in the post translational processing...
| Keywords: | Anti-CTSB, Anti-CPSB, Cathepsin B Polyclonal Antibody(Capture/Detector) |
| Application: | ELISA Capture/Detector |
| Host: | Rabbit |
| Species reactivity: | human |
From 158.00€
*
CTSB Protein (His Tag) (recombinant mouse)
Item number: E-PDMM100090.100
Sequence: His18-Asp333. Fusion tag: C-His Endotoxin: < 1.0 EU per µg of the protein as determined by the LAL method Observed Molecular Mass: 40-45 kDa. Protein function: Cathepsin B is a papain-family cysteine protease that is normally located in lysosomes, where it is involved in the turnover of proteins and plays...
| Keywords: | Ctsb, Recombinant Mouse CTSB Protein(His Tag) |
| Expressed in: | Mammalian |
| Origin: | mouse |
From 304.00€
*
K777
Item number: TGM-T15641-25mg
Description: K777 is a potent, orally active, and irreversible inhibitor of cysteine protease, functioning as a potent CYP3A4 inhibitor (IC50 = 60 nM) and a selective CCR4 antagonist, which inhibits chemotaxis. K777 irreversibly inhibits Cruzain, the major cysteine protease of Trypanosoma cruzi, and cathepsins B and...
| Keywords: | APC-3316 |
| Application: | Potent irreversible cysteine protease inhibitor |
| CAS | 233277-99-1 |
| MW: | 574.73 D |
From 77.00€
*