58 products were found matching "K00911"!
No results were found for the filter!
TNP
Item number: TGM-T4487-10mg
Description: TNP (IP3K Inhibitor) is a cell-permeable inhibitor of IP6K1 and IP3K, with IC 50 values of 0.55 µM and 10.2 µM for IP6K1 and IP3K, respectively. TNP binds to the ATP-binding sites of both enzymes [1]. Target: Others. Smiles: [O-][N+](=O)c1ccc(CNc2nc(NCc3cccc(c3)C(F)(F)F)nc3[nH]cnc23)cc1. References:...
| Keywords: | IP3K Inhibitor |
| Application: | IP3K inhibitor |
| CAS | 519178-28-0 |
| MW: | 443.38 D |
From 42.00€
*
ITPKB Protein, Human, Recombinant (His & SUMO)
Item number: TGM-TMPH-01534-100ug
Description: N/A. ITPKB Protein, Human, Recombinant (His & SUMO) is expressed in E. coli expression system with N-6xHis-SUMO tag. The predicted molecular weight is 72.5 kDa and the accession number is P27987.
| Keywords: | ITPKB, Inositol-trisphosphate 3-kinase B, Inositol 1,4,5-trisphosphate 3-kinase B |
| MW: | 72.5 kD |
From 198.00€
*
BAMB-4
Item number: TGM-T14496-100mg
Description: BAMB-4 (ITPKA-IN-C14) is a highly membrane-permeable inhibitor of inositol-1,4,5-trisphosphate-3-kinase A (ITPKA), effectively suppressing the metastasis-promoting effect of ITPKA in lung tumor cells (with IC50 of 37 µM in ADP-Glo Assay). Target: Others. Smiles: Cc1ccc(cc1)C(=O)Nc1noc2ccccc12....
| Keywords: | ITPKA-IN-C14 |
| Application: | Inositol-trisphosphate 3-kinase A (ITPKA) inhibitor |
| CAS | 891025-25-5 |
| MW: | 252.27 D |
From 88.00€
*
Anti-ITPKC
Item number: CSB-PA003041.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Keywords: | Anti-ITPKC, Anti-IP3KC, Anti-IP3K C, EC=2.7.1.127, Anti-IP3 3-kinase C, Anti-InsP 3-kinase C, Anti-Inositol-trisphosphate... |
| Application: | ELISA, WB, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 126.00€
*
Anti-ITPKA
Item number: CSB-PA003055.50
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Keywords: | Anti-ITPKA, Anti-IP3K A, EC=2.7.1.127, Anti-IP3 3-kinase A, Anti-InsP 3-kinase A, Anti-Inositol-trisphosphate 3-kinase A,... |
| Application: | ELISA, WB, IF |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
126.00€
*
Anti-ITPKC
Item number: CSB-PA876631.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Keywords: | Anti-ITPKC, Anti-IP3KC, Anti-IP3K C, EC=2.7.1.127, Anti-IP3 3-kinase C, Anti-InsP 3-kinase C, Anti-Inositol-trisphosphate... |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | human |
283.00€
*
Inositol-trisphosphate 3-kinase B (ITPKB), partial,...
Item number: CSB-EP011910HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 442-946aa. Protein Length: Partial. Tag Info: N-terminal 6xHis-SUMO-tagged. Target Protein Sequence: RVEGGSPTLG LLGGSPSAQP GTGNVEAGIP SGRMLEPLPC WDAAKDLKEP QCPPGDRVGV QPGNSRVWQG TMEKAGLAWT RGTGVQSEGT WESQRQDSDA LPSPELLPQD PDKPFLRKAC SPSNIPAVII...
| Keywords: | ITPKB, IP3K B, EC=2.7.1.127, IP3 3-kinase B, InsP 3-kinase B, Inositol-trisphosphate 3-kinase B, Inositol... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 72.5 kD |
From 219.00€
*
Anti-IP3KC, Internal
Item number: ARG64784.100
Protein function: Can phosphorylate inositol 2,4,5-triphosphate to inositol 2,4,5,6-tetraphosphate. [The UniProt Consortium]
| Keywords: | Anti-IP3KC, Anti-ITPKC, Anti-IP3K C, EC=2.7.1.127, Anti-IP3 3-kinase C, Anti-InsP 3-kinase C, Anti-Inositol-trisphosphate... |
| Application: | ELISA, WB |
| Host: | Goat |
| Species reactivity: | human |
822.00€
*
Anti-IP3KC
Item number: NSJ-R34013-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: Inositol 1,4,5-trisphosphate 3-kinase C, ITPKC Protein function: Can phosphorylate inositol 2,4,5-triphosphate to inositol 2,4,5,6-tetraphosphate. [The UniProt Consortium]
| Keywords: | Anti-ITPKC, Anti-IP3KC, Anti-IP3K C, EC=2.7.1.127, Anti-IP3 3-kinase C, Anti-InsP 3-kinase C, Anti-Inositol-trisphosphate... |
| Application: | WB, ELISA (peptide) |
| Host: | Goat |
| Species reactivity: | human |
790.00€
*
TNP
Item number: Cay21189-1
TNP is a cell-permeable inhibitor of inositol-1,4,5-trisphosphate 6-kinase 1 (IP6K1, IC50 = 0.55 µM, Ki = 0.24 µM) and IP3K (IC50 = 10.2 µM, Ki = 4.3 µM) that binds to the ATP-binding sites of both enzymes. TNP reduces IP7 and IP8 levels (IC50s = ~3 and 1 µM, respectively) and inhibits insulin release in MIN6...
| Keywords: | IP3K Inhibitor, IP6K Inhibitor, N6-[(4-nitrophenyl)methyl]-N2-[[3-(trifluoromethyl)phenyl]methyl]-9H-purine-2,6-diamine |
| Application: | IP3K inhibitor |
| CAS | 519178-28-0 |
| MW: | 443.4 D |
From 61.00€
*
Anti-ITPKB
Item number: ARG40333.100
| Keywords: | Anti-ITPKB, Anti-IP3K B, EC=2.7.1.127, Anti-IP3 3-kinase B, Anti-InsP 3-kinase B, Anti-Inositol-trisphosphate 3-kinase B,... |
| Application: | IHC (paraffin), WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
658.00€
*
Anti-ITPKB
Item number: ARG40383.100
| Keywords: | Anti-ITPKB, Anti-IP3K B, EC=2.7.1.127, Anti-IP3 3-kinase B, Anti-InsP 3-kinase B, Anti-Inositol-trisphosphate 3-kinase B,... |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
658.00€
*