4 products were found matching "98008-06-1"!
No results were found for the filter!
Fulvestrant sulfone
Item number: TGM-T71710-10mg
Description: Fulvestrant sulfone is a synthetic estrogen receptor antagonist. Target: Others. Smiles: C(CCCCCCCCS(CCCC(C(F)(F)F)(F)F)(=O)=O)[C@H]1[C@@]2([C@@](C=3C(C1)=CC(O)=CC3)(CC[C@@]4(C)[C@]2(CC[C@@H]4O)[H])[H])[H]
| Application: | Fulvestrant derivative, estrogen receptor antagonist |
| CAS | 98008-06-1 |
| MW: | 622.77 D |
From 164.00€
*
Fulvestrant-9-sulfone
Item number: ESS0116.100mg
C 61.72% H 7.61% F 15.25% O 10.28% S 5.15%
| Application: | Fulvestrant EP Impurity B |
| CAS | 98008-06-1 |
| MW: | 622.78 D |
From 659.00€
*
Fulvestrant-9-sulfone-D3
Item number: ESS0158.10mg
C 61.42% H 7.09% F 15.18% O 10.23% S 5.12% D 0.97%
| Keywords: | (7alpha,17beta)-7-[9-[(4,4,5,5,5-Pentafluoropentyl)sulfonyl]nonyl]estra-1,3,5(10)-triene-3,17-diol-d3,... |
| Application: | Labelled analog of Fulvetrant Impurity B |
| CAS | 98008-06-1 |
| MW: | 625.8 D |
From 1,319.00€
*
Fulvestrant 9-sulfone
Item number: Cay35070-1
Fulvestrant 9-sulfone is an estrogen receptor antagonist and a derivative of the selective estrogen receptor degrader (SERD) fulvestrant (Cay-10011269). It binds to estrogen receptor alpha (ERalpha) and ERbeta and inhibits estrogen-induced gene expression in a reporter assay in Ishikawa endometrial cells expressing...
| Keywords: | 7alpha-[9-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]nonyl]-estra-1,3,5(10)-triene-3,17beta-diol |
| Application: | Fulvestrant derivative, Estrogen receptor antagonist |
| CAS | 98008-06-1 |
| MW: | 622.8 D |
From 90.00€
*
