Description: Glutathione ethyl ester, a cell-permeable GSH donor, enhances the in vitro production of embryos by bolstering antioxidative defense, thereby ensuring an effective GSH supply to the oocyte [1]. Target: Reactive Oxygen Species. Smiles: CCOC(=O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](N)C(O)=O

Glutathione (GSH) ethyl ester is a cell-permeable derivative of GSH (Cay-10007461), a nucleophilic co-substrate to glutathione transferases. It increases mitochondrial GSH levels in C38 and IB3-1 epithelial lung cystic fibrosis cells when used at a concentration of 10 mM. GSH ethyl ester (10 mM) decreases reactive...

Solid. Soluble in DMSO. GSH-OEt is cellpermeable and has been used to protect cells against radiation damage, oxidants and various toxic compounds including heavy metals. GSH-OEt is a protective agent against cellular damage, such as cataracts and mitochondrial degeneration. It undergoes hydrolysis by intracellular...