3 products were found matching "81-88-9"!
No results were found for the filter!
Rhodamine B
Item number: TGM-T7975-100mg
Description: Rhodamine B (Brilliant Pink B) is used as a tracer dye in water to determine the rate and direction of flow and transport. Target: Others. Smiles: [Cl-].CCN(CC)c1ccc2c(-c3ccccc3C(O)=O)c3ccc(cc3oc2c1)=[N+](CC)CC. References: Tan D , Bai B , Jiang D , et al. Rhodamine B induces long nucleoplasmic bridges...
| Keywords: | Rhodamine O, Basic Violet 1, Rhodamine B, Brilliant Pink B, Tetraethylrhodamine |
| CAS | 81-88-9 |
| MW: | 479.01 D |
From 34.00€
*
Rhodamine B
Item number: CDX-R0003-G100
Rhodamine B is a fluorescent xanthene dye widely used in various applications, including histology, due to its bright red to pink fluorescence when exposed to ultraviolet (UV) light. Rhodamine B is used as a tracer dye in water studies to track the movement of water, determine flow rates, and identify leaks in...
| Keywords: | Tetraetylrhodamine, Basic Violet 10, Brilliant Pink B, C.I. 45170, Rhodamine 610 chloride, Rheonine B,... |
| Application: | Staining, fluorescent xanthene dye |
| CAS | 81-88-9 |
| MW: | 479,01 D |
From 97.00€
*
Rhodamine B *Fluorescence reference standard*
Item number: ABD-69
Rhodamine B (also called Rhodamine 610, Basic Violet 10, or C.I. 45170) is used as a fluorescent staining dye, sometimes in combination with auramine O.
| Application: | Labeling |
| CAS | 81-88-9 |
110.00€
*
