3 products were found matching "778277-15-9"!
No results were found for the filter!
GNF-5
Item number: TGM-T1803-100mg
Description: GNF-5 is a specific non-ATP competitive inhibitor of Bcr-Abl (IC50: 0.22±0.1 uM, Wild-type Abl). It is an analog of GNF-2 with improved pharmacokinetic properties. Target: SARS-CoV, Bcr-Abl. Smiles: N(C1=CC(=NC=N1)C2=CC(C(NCCO)=O)=CC=C2)C3=CC=C(OC(F)(F)F)C=C3. References: Zhang J, et al. Nature. 2010,...
| Keywords: | GNF 5 |
| Application: | BCR-Abl inhibitor |
| CAS | 778277-15-9 |
| MW: | 418.37 D |
From 33.00€
*
GNF-5
Item number: Cay16254-10
GNF-5 is an allosteric inhibitor of Bcr-Abl (IC50 = 0.121 µM) and a derivative of GNF-2 (Cay-16253). It also inhibits the Bcr-Abl mutants Bcr-AblG250E, Bcr-AblE255V, and Bcr-AblM351T (IC50s = 4.52, 0.38, and 0.93 µM, respectively). GNF-5 inhibits the growth of Ba/F3 cells (IC50 = 0.145 µM). It reduces viral titers...
| Keywords: | N-(2-hydroxyethyl)-3-[6-[[4-(trifluoromethoxy)phenyl]amino]-4-pyrimidinyl]-benzamide |
| Application: | BCR-Abl inhibitor |
| CAS | 778277-15-9 |
| MW: | 418.4 D |
From 50.00€
*
GNF-5
Item number: LKT-G5322.100
Abl inhibitor.
| Application: | Abl inhibitor |
| CAS | 778277-15-9 |
| MW: | 418.38 D |
From 69.00€
*
