Description: Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II. Target: Others. Smiles: C(OCc1ccccc1)[C@H]1NC[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1

Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II.Formal Name: 3R,4R,5S-tris(phenylmethoxy-2R-[(phenylmethoxy)methyl]-piperidine. CAS Number: 69567-11-9. Synonyms: DNJ...