2 products were found matching "63442-81-9"!
No results were found for the filter!
L,L-Dityrosine
Item number: TGM-T19396-10mg
Description: L,L-Dityrosine, a component found in the acid hydrolysates of various biological materials, such as insect cuticular resilin, plays a significant role in biochemical processes. Target: Others. Smiles: N[C@@H](Cc1ccc(O)c(c1)-c1cc(C[C@H](N)C(O)=O)ccc1O)C(O)=O. References: Kungl AJ, et al. Molecular...
| Keywords: | o,o'-Dityrosine |
| CAS | 63442-81-9 |
| MW: | 360.36 D |
From 329.00€
*
L,L-Dityrosine
Item number: Cay35746-1
L,L-Dityrosine is an amino acid conjugate containing two L-tyrosine molecules. L-Tyrosine residues in fibrinogen proteins can form L,L-dityrosine cross-links between fibrinogen proteins in the presence of hematin and plasma-generated hydrogen peroxide under non-thermal plasma exposure. L-Tyrosine residues in human,...
| Keywords: | alpha3S,alpha3'S-diamino-6,6'-dihydroxy-[1,1'-biphenyl]-3,3'-dipropanoic acid |
| Application: | Amino acid conjugate |
| CAS | 63442-81-9 |
| MW: | 360.4 D |
From 53.00€
*
