3 products were found matching "5601-74-1"!
No results were found for the filter!
Ophiobolin B
Item number: TGM-T12313-1mg
Description: Ophiobolin B is a sesterterpene Helminthosporium oryzae metabolite, inhibits proton extrusion from maize coleoptiles. Target: Others. Smiles: [H][C@]12C[C@@]3(C)CC[C@](O)([C@@H](C)CCC=C(C)C)[C@]3([H])C\C=C(C=O)/[C@@]1([H])C(=O)C[C@@]2(C)O. References: Gianani L, et al. Effects of ophiobolin B on cell...
| Application: | Calmodulin antagonist |
| CAS | 5601-74-1 |
| MW: | 402.57 D |
From 839.00€
*
Ophiobolin B
Item number: Cay18432-1
Calmodulin is a calcium-sensing protein that regulates a wide array of proteins involved in diverse cellular functions. Ophiobolin B is a sesterterpenoid fungal phytotoxin that binds and irreversibly antagonizes calmodulin, producing cytotoxic and antimicrobial effects. It induces apoptosis in chronic lymphocytic...
| Keywords: | Cochliobolin B, Ophiobolsin A, Zizanin B,... |
| Application: | Calmodulin antagonist |
| CAS | 5601-74-1 |
| MW: | 402.6 D |
From 458.00€
*
Ophiobolin B
Item number: LKT-O610292.1
| Keywords: | Cochliobolin B, 3,14-Dihydroxy-5-oxoophiobola-7,19-dien-25-al, CHEMBL478388, Ophiobola-7,19-dien-25-al,... |
| Application: | Calmodulin antagonist |
| CAS | 5601-74-1 |
| MW: | 402.58 D |
From 594.00€
*
