3 products were found matching "52050-17-6"!
No results were found for the filter!
Glucosylsphingosine
Item number: TGM-T78493-1mg
Description: Glucosylsphingosine (lyso-Gb1), a deacylated glucosylceramide derivative metabolized by glucocerebrosidase, serves as a promising, reliable, and specific biomarker for Gaucher disease monitoring [1]. Target: Others. Smiles: CCCCCCCCCC CCC\C=C\[C@@H](O)[C@@H](N)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
| Keywords: | Glucopsychosine, Lyso-Gb1 |
| Application: | Cytotoxic compound |
| CAS | 52050-17-6 |
| MW: | 461.63 D |
From 274.00€
*
1-beta-D-Glucosylsphingosine (d18:1)
Item number: Cay23211-1
1-beta-D-Glucosylsphingosine is a glucosylsphingosine, which are deacetylated lysolipid derivatives of glucocerebrosides (Cay-23207). They are formed when sphingosines undergo glucosidation by UDP-glucose. Glucosylsphingosines completely reduce neurite outgrowth and induce death of LA-N-2 cells at concentrations of...
| Keywords: | 1-beta-D-Glucosylsphingosine (synthetic), Glucosyl-C18-Sphingosine, Glucosylsphingosine (d18:1),... |
| Application: | Cytotoxic compound |
| CAS | 52050-17-6 |
| MW: | 461.6 D |
From 139.00€
*
1-beta-D-Glucosylsphingosine
Item number: Cay31556-1
1-beta-D-Glucosylsphingosine is a glucosylsphingosine, which are deacetylated lysolipid derivatives of glucocerebrosides (Cay-23206, Cay-23207, Cay-25850). They are formed when sphingosines undergo glucosidation by UDP-glucose. Glucosylsphingosines completely reduce neurite outgrowth and induce death of LA-N-2 cells...
| Keywords: | Glucosyl-C18-sphingosine, Glucosylsphingosine (d18:1), (2S,3R,4E)-2-amino-3-hydroxy-4-octadecen-1-yl, beta-D-glucopyranoside |
| Application: | Glucocerebroside lysolipid derivative |
| CAS | 52050-17-6 |
| MW: | 461.6 D |
From 150.00€
*
