Description: Glycyl-L-histidyl-L-lysine is a synthetic hepatotrophic agent and liver cell growth factor that stimulates the production of hepatic erythropoietic factor. Target: Others. Smiles: [C@H](CC1=CN=CN1)(C(N[C@@H](CCCCN)C(O)=O)=O)NC(CN)=O. References: Naughton BA,etal.The influence of pancreatic hormones and...

GHK is a peptide released during extracellular matrix (ECM) protein degradation following tissue injury. It binds to copper to form GHK-Cu, a complex with diverse biological activities, including roles in tissue remodeling and wound healing, hair growth, and suppression of inflammation. GHK (1 µM) increases...

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...