Description: Ochratoxin B is produced by a variety of Aspergillus and Penicillium species and is an analog of the mycotoxin Ochratoxin A, which can contaminate agricultural products. Target: Endogenous Metabolite. Smiles: OC1=C2C(=CC=C1C(N[C@@H](CC3=CC=CC=C3)C(O)=O)=O)C[C@@H](C)OC2=O. References: Mally A, et al....

Ochratoxin B (OTB) is a mycotoxin that has been found in Aspergillus and is a non-chlorinated derivative of OTA (Cay-11439). Unlike OTA, OTB is not genotoxic to HepG2 cells but does inhibit cell division when used at concentrations ranging from 1 to 25 µg/ml. It induces mortality (LC50 = 700 nM) and craniofacial...