3 products were found matching "48208-26-0"!
No results were found for the filter!
RG108
Item number: TGM-T2038-100mg
Description: RG108 (N-Phthalyl-L-tryptophan) is a DNA methyltransferase inhibitor with an IC50 of 115 nM. Target: DNA Methyltransferase. Smiles: [C@H](CC=1C=2C(NC1)=CC=CC2)(C(O)=O)N3C(=O)C=4C(C3=O)=CC=CC4. References: Brueckner B, et al, Cancer Res, 2005, 65(14), 6305-6311.
| Keywords: | N-Phthalyl-L-tryptophan |
| Application: | DNA methyltransferase inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.33 D |
From 40.00€
*
RG108
Item number: Cay13302-10
DNA methylation regulates gene expression in normal and malignant cells. RG108 is a non-nucleoside DNA methyltransferase inhibitor (IC50 = 115 nM in vitro). It significantly reduces the methylation of genomic DNA in cells at 10 µM without detectable toxicity, distinguishing it from nucleoside-based inhibitors like...
| Keywords: | N-Phthalyl-L-Tryptophan, alpha-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-(alphaS)-1H-indole-3-propanoic acid |
| Application: | DNA methyltransferase inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.3 D |
From 85.00€
*
RG-108
Item number: LKT-R2400.10
DNMT inhibitor.
| Application: | DNMT inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.33 D |
From 125.00€
*
