Description: Diphenyleneiodonium chloride (DPI)(DPI) is an irreversible inhibitor of iNOS and eNOS (IC50 values of 50 nM and 0.3 µM, respectively),and displays broad-spectrum bactericidal activity. Target: TRP/TRPV Channel, NADPH, Reactive Oxygen Species, NOS. Smiles: [Cl-].[I+]1c2ccccc2-c2ccccc12. References:...

Diphenyleneiodonium (DPI) is an inhibitor of NADPH oxidase (NOX, EC50 = 0.1 µM in HeLa cells). It also inhibits nitric oxide synthase (NOS, IC50 = 0.05 µM in isolated mouse peritoneal macrophages). DPI (10, 50, and 100 µM) induces the production of reactive oxygen species (ROS) in, and apoptosis of, human umbilical...