Description: KIN1400, a novel IRF3 activator, triggers IRF3-dependent innate immune antiviral genes and IFNbeta307 expression, suppresses WNV, DV infection, and HCV replication. Target: Others. Smiles: C(NC1=NC=2C(S1)=CC=CC2)(C3=C(O)C4=C(C=C3)C=CC=N4)C5=CC=C(OC(F)F)C=C5

KIN1400 is a small molecule activator of the RIG-1-like receptor (RLR) pathway that has antiviral activity. It induces expression of the innate immune genes RIG-1, MDA5, IFIT1, IFIT2, IFITM1, OAS3, and Mx1 in THP-1 cells stimulated with phorbol 12-myristate 13-acetate (PMA, Cay-10008014). KIN1400 (20 µM) reduces...