2 products were found matching "4373-41-5"!
No results were found for the filter!
Maslinic acid
Item number: TGM-T3772-100mg
Description: Maslinic acid (Crategolic acid) is a DNA polymerase B inhibitor. Target: NF-kappaB, DNA/RNA Synthesis, HIV Protease, Antibacterial. Smiles: CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O. References: Umehara K,et al.Studies on...
| Keywords: | 2alpha-Hydroxyoleanolic acid, 2alpha-Hydroxyoleanoic Acid, Crategolic acid |
| CAS | 4373-41-5 |
| MW: | 472.7 D |
From 31.00€
*
Maslinic Acid
Item number: Cay10009645-1
Maslinic acid is found in a number of natural sources, most notably pomace olive oil (orujo). This pentacyclic triterpene has an antiproliferative effect against Caco-2 cancer cells (EC50 = 15 µM), HT-29 human colon cancer cells (EC50 = 74 µM), 1321N1 astrocytoma cells (IC50 = 25 µM), and human leukemia (CCRF-CEM...
| Keywords: | 2alpha-Hydroxyoleanoic Acid, Crategolic Acid, 2alpha,3beta-dihydroxy-olean-12-en-28-oic acid |
| Application: | NO production inhibitor |
| CAS | 4373-41-5 |
| MW: | 472.7 D |
From 42.00€
*
