3 products were found matching "425399-05-9"!
No results were found for the filter!
CASIN
Item number: TGM-T3971-100mg
Description: CASIN (Pirl1-related Compound 2) is a specific inhibitor of GTPase Cdc42 (IC50: 2 uM). Target: STAT, Ras, CDK. Smiles: OCCNC1CCCc2c1[nH]c1ccc(cc21)-c1ccccc1. References: Li Y,et al. Suppression of cancer relapse and metastasis by inhibiting cancer stemness. Proc Natl Acad Sci U S A. 2015 Feb...
| Keywords: | Pirl1-related Compound 2 |
| Application: | Cdc42 GTPase activation inhibitor |
| CAS | 425399-05-9 |
| MW: | 306.4 D |
From 33.00€
*
CASIN
Item number: Cay17694-50
The Rho family of GTPases regulates diverse signal transduction pathways. One member, the cell division control protein 42 homolog (Cdc42), is involved in filopodia function, cell polarity, cell cycling, and other processes. CASIN is an indole-based small molecule that inhibits activation of the Cdc42 GTPase (IC50 =...
| Keywords: | Pirl1-related Compound 2, 2-[(2,3,4,9-tetrahydro-6-phenyl-1H-carbazol-1-yl)amino]-ethanol |
| Application: | Cdc42 GTPase activation inhibitor |
| CAS | 425399-05-9 |
| MW: | 306.4 D |
From 44.00€
*
Casin
Item number: LKT-C0273.1
Cdc42 GTPase inhibitor.
| Application: | Cdc42 GTPase inhibitor |
| CAS | 425399-05-9 |
| MW: | 306.41 D |
From 94.00€
*
