Description: 10058-F4 (c-Myc Inhibitor) is a cell-permeable thiazolidinone that specifically inhibits the c-Myc-Max interaction and prevents transactivation of c-Myc target gene expression, induces cell-cycle arrest and apoptosis. Target: Autophagy, c-Myc. Smiles: CCC1=CC=C(\C=C2/SC(=S)NC2=O)C=C1. References: Huang...

The Myc proto-oncogenes interact with Max to form a dimer that regulates gene transcription. The protein c-Myc, in particular, promotes gene expression relevant to cell growth and thus drives cancer. 10058-F4 is a cell-permeable thiazolidinone that inhibits the dimerization of c-Myc and Max at 64 µM, preventing...

c-Myc is a proto-oncogene that plays an important role in cell proliferation, differentiation, and apoptosis. 5-[(4-Ethylphenyl)methylene]-2-thioxo-4-thiazolidinone [10058-F4] is a cell-permeable thiazolidinone compound that specifically inhibits the c-Myc-Max interaction/dimerization at 64 µM, preventing...