Description: OAC1 (BAS 00287861) is a compound activating Octamer-binding transcription factor 4 (Oct4). It enhances the iPSC reprogramming efficiency and accelerates the reprogramming process. Target: OCT. Smiles: O=C(Nc1cc2cc[nH]c2cn1)c1ccccc1. References: Li W, et al. Proc Natl Acad Sci U S A, 2012, 109(51),...

Octamer-binding transcription factor 4 (Oct4) is a transcription factor that, with Sox2, Klf4, and c-Myc, is involved in the reprogramming of somatic cells to produce pluripotent stem cells. OAC1 is an Oct4-activating compound that activates expression through the Oct4 gene promoter. In cells expressing Oct4 with...