3 products were found matching "298-96-4"!
No results were found for the filter!
Tetrazolium Red
Item number: TGM-T19577-1mL
Description: Tetrazolium Red (2,3,5-Triphenyltetrazolium chloride) is employed to visualize dehydrogenase enzyme activity. Target: Others. Smiles: [Cl-].c1ccc(cc1)-c1nn(-c2ccccc2)[n+](n1)-c1ccccc1
| Keywords: | TTC, TPTZ, 2,3,5-Triphenyltetrazolium chloride |
| CAS | 298-96-4 |
| MW: | 334.8 D |
From 38.00€
*
Tetrazolium (chloride)
Item number: Cay17342-5
TTC is a redox indicator used to detect cellular respiration. It is primarily reduced by Complex I in mitochondria and, under anaerobic conditions, is completely reduced to an insoluble red 1,3,5-triphenylformazan. TTC assays are typically used as a mitochondrial redox potential indicator for cell death.Formal Name:...
| Keywords: | 2,3,5-Triphenyl Tetrazolium Chloride, Tetrazolium red, TTC, 2,3,5-triphenyl-2H-tetrazolium, monochloride |
| Application: | Redox indicator |
| CAS | 298-96-4 |
| MW: | 334.8 D |
From 44.00€
*
Triphenyltetrazolium chloride
Item number: CDX-T0026-G025
Solid. Soluble in acetone or methanol. Triphenyl tetrazolium chloride, TTC, or simply tetrazolium chloride is a redox indicator commonly used in biochemical experiments especially to indicate cellular respiration.
| Keywords: | TTC |
| Application: | Redox indicator |
| CAS | 298-96-4 |
| MW: | 334,8 D |
From 121.00€
*
