3 products were found matching "2630904-45-7"!
No results were found for the filter!
MRTX1719
Item number: LKT-M704793.1
MRTX1719 is an inhibitor of the PRMT5/MTA complex and may be effective against MTAP-deleted cancers. SMILES: CN1C(=C(C=N1)C2=CC3=C(C=C2)C(=O)NN=C3CN)C4=C(C(=CC(=C4F)Cl)OC5CC5)C#N
| Keywords: | MRTX-1719,... |
| Application: | PRMT5/MTA complex inhibitor |
| CAS | 2630904-45-7 |
From 298.00€
*
MRTX-1719
Item number: Cay36563-1
MRTX-1719 is an inhibitor of the protein arginine methyltransferase 5 (PRMT5) and methylthioadenosine (MTA) complex. It selectively binds to the PRMT5/MTA complex over the PRMT5 and S-adenosyl-L-methionine (SAM) complex (Kds = 0.14 and 9.4 pM, respectively). MRTX-1719 selectively decreases protein dimethylarginine...
| Keywords: | (M)-27,... |
| Application: | PRMT5/MTA complex inhibitor |
| CAS | 2630904-45-7 |
| MW: | 464.9 D |
From 237.00€
*
MRTX-1719
Item number: TGM-T40254-100mg
Description: MRTX-1719 is a potent, first-in-class, selective inhibitor of the PRMT5/MTA complex, with an IC50 of less than 10 nM in PRMT5/MTA MTAP DEL SDMA cells. Target: Histone Methyltransferase. Smiles: CN1C(=C(C=N1)C=2C=C3C(=CC2)C(=O)NN=C3CN)C4=C(C#N)C(OC5CC5)=CC(Cl)=C4F. References: Targeting the genetic and...
| CAS | 2630904-45-7 |
| MW: | 464.88 D |
From 397.00€
*
