3 products were found matching "2244-11-3"!
No results were found for the filter!
Alloxan monohydrate
Item number: TGM-T7814-1g
Description: Alloxan Monohydrate is a glucose analog used to induce diabetes by destroying beta-cells. Target: Proteasome. Smiles: O.O=C1NC(=O)C(=O)C(=O)N1. References: Major species differences between humans and rodents in the susceptibility to pancreatic beta-cell injury.
| CAS | 2244-11-3 |
| MW: | 160.09 D |
30.00€
*
Alloxan (hydrate)
Item number: Cay9002196-5
Alloxan is a toxin that selectively eliminates pancreatic beta-cells in mice, rats, and certain other animals, and is used to model type 1 diabetes in humans. Reduction of alloxan within beta-cells precedes the generation of reactive oxygen species, which in turn contribute to beta-cell death. The dose of alloxan...
| Keywords: | 2,4,5,6(1H,3H)-pyrimidinetetrone, monohydrate |
| Application: | beta-cell elimination |
| CAS | 2244-11-3 |
| MW: | 160.1 D |
From 44.00€
*
Alloxan Monohydrate
Item number: LKT-A4547.10
Pyrimidine, glucose analog, used to induce diabetes
| Keywords: | Alloxan, 2,4,5,6(1H,3H)-pyrimidinetetrone monohydrate |
| Application: | Pyrimidine, glucose analog, used to induce diabetes |
| CAS | 2244-11-3 |
| MW: | 160.08 D |
From 71.00€
*
