4 products were found matching "22232-54-8"!
No results were found for the filter!
Carbimazole
Item number: TGM-T0952-1mL
Description: Carbimazole (Athyromazole) is an Imidazolium thyroid antagonist, which is rapidly transformed into MMI in vivo and can be converted into methidazole in vitro, and can be used in the study of Graves' disease. Target: Thyroid hormone receptor(THR). Smiles: C(OCC)(=O)N1C(=S)N(C)C=C1. References: Taurog A,...
| Keywords: | Neomercazole, Carbimazol, Athyromazole |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
From 31.00€
*
Carbimazole
Item number: LKT-C0172.1
Carbimazole is a thyroid inhibitor.
| Keywords: | Athyromazole, Neo-mercazole, Neo-Thyreostat |
| Application: | Antithyroid |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
From 96.00€
*
Carbimazole
Item number: Cay28280-10
Carbimazole is a prodrug form of the thyroid hormone synthesis inhibitor methimazole (Cay-23718). Carbimazole (15 mg/animal) reduces total thyroxine concentration, thyroid enlargement, polyphagia, anorexia, and alopecia in a cat model of hyperthyroidism.Formal Name:...
| Keywords: | 2,3-dihydro-3-methyl-2-thioxo-1H-imidazole-1-carboxylic acid, ethyl ester |
| Application: | Methimazole prodrug, antithyroid, thyroid hormone synthesis inhibitor |
| CAS | 22232-54-8 |
| MW: | 186.2 D |
From 78.00€
*
Carbimazole
Item number: LKT-C0172.100
Methimazole prodrug, thyroid peroxidase inhibitor.
| Keywords: | Athyromazole, Neo-mercazole, Neo-Thyreostat, 2,3-Dihydro-3-methyl-2-thioxo-1H-imidazole-1- carboxylic acid ethyl ester |
| Application: | Antithyroid |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
67.00€
*
