Description: Reversin 121, a P-glycoprotein inhibitor, enhances MDR1's ATPase activity and counteracts P-glycoprotein-mediated multidrug resistance, making it useful in cancer research. Smiles: [C@@H](C(N[C@@H](CCCCNC(OCC1=CC=CC=C1)=O)C(OC(C)(C)C)=O)=O)(CC(OCC2=CC=CC=C2)=O)NC(OC(C)(C)C)=O

Reversin 121 is a hydrophobic peptide chemosensitizer that can reverse P-glycoprotein-mediated multidrug resistance. It binds to the P-glycoprotein multidrug transporter (MDR1) with a Kd value of 77 nM. Reversin 121 modulates P-glycoprotein ATPase activity in Sf9 insect cell membranes expressing human MDR1, plasma...