2 products were found matching "1660114-31-7"!
No results were found for the filter!
NIK SMI1
Item number: TGM-T16290-100mg
Description: NIK SMI1 is an effective and selective NF-kappaB inducing kinase (NIK) inhibitor. It also inhibits NIK-catalyzed hydrolysis of ATP to ADP (IC50: 0.23±0.17 nM). Target: NF-kappaB. Smiles: COc1cc(nc(c1)-c1cccc(c1)C#C[C@]1(O)CCN(C)C1=O)C(N)=O. References: Blaquiere N, et al. Scaffold-Hopping Approach To...
| Application: | NIK inhibitor |
| CAS | 1660114-31-7 |
| MW: | 365.38 D |
From 161.00€
*
NIK SMI1
Item number: Cay37750-1
NIK SMI1 is an inhibitor of NF-kappaB-inducing kinase (NIK, Ki = 0.23 nM). It inhibits NF-kappaB activation in a reporter assay using HEK293 cells (IC50 = 34 nM). NIK SMI1 inhibits B cell activating factor-induced survival of isolated mouse splenic B cells (IC50 = 373 nM).Formal Name:...
| Keywords: | 6-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxo-3-pyrrolidinyl]ethynyl]phenyl]-4-methoxy-2-pyridinecarboxamide |
| Application: | NIK inhibitor |
| CAS | 1660114-31-7 |
| MW: | 365.4 D |
From 78.00€
*
