2 products were found matching "157047-97-7"!
No results were found for the filter!
Benzomalvin B
Item number: TGM-T38033-1mg
Description: Benzomalvin B is a fungal metabolite originally isolated from Penicillium. It acts as an antagonist of neurokinin-1 (NK1) receptors, inhibiting binding of substance P by 24% in vitro when used at a concentration of 100 µg/ml. Target: Others. Smiles: CN1C(=O)c2ccccc2-n2c(nc3ccccc3c2=O)\C1=C/c1ccccc1
| Application: | Fungal metabolite, substance-P receptor antagonist |
| CAS | 157047-97-7 |
| MW: | 379.419 D |
From 274.00€
*
Benzomalvin B
Item number: Cay25088-1
Benzomalvin B is a fungal metabolite originally isolated from Penicillium. It acts as an antagonist of neurokinin-1 (NK1) receptors, inhibiting binding of substance P (Cay-24035) by 24% in vitro when used at a concentration of 100 µg/ml.Formal Name:...
| Keywords: | (7E)-(+)-6,7-dihydro-6-methyl-7-(phenylmethylene)-quinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
| Application: | Fungal metabolite, substance-P receptor antagonist |
| CAS | 157047-97-7 |
| MW: | 379.4 D |
From 259.00€
*
