4 products were found matching "14930-96-2"!
No results were found for the filter!
Cytochalasin B
Item number: Cay11328-10
Cytochalasin B is a cell-permeable mycotoxin which binds to the barbed end of actin, reversibly inhibiting the elongation and shortening of actin filaments. By disrupting actin polymerization, cytochalasin B blocks diverse cellular functions, including cell division, migration, phagocytosis, exocytosis, chemotaxis,...
| Keywords: | NSC 107658, Phomin,... |
| Application: | Mycotoxin |
| CAS | 14930-96-2 |
| MW: | 479.6 D |
From 60.00€
*
Cytochalasin B
Item number: TGM-T7097-1mg
Description: Cytochalasin B is a mycotoxin binding to the barbed end of actin filaments. It can disrupt the formation of actin polymers (Kd: 1.4-2.2 nM for F-actin). Target: Arp2/3 Complex. Smiles: [H][C@]12[C@H](Cc3ccccc3)NC(=O)C11OC(=O)\C=C\[C@H](O)CCC[C@@H](C)C\C=C\[C@@]1([H])[C@H](O)C(=C)[C@H]2C. References:...
| Keywords: | Phomin |
| Application: | Mycotoxin |
| CAS | 14930-96-2 |
| MW: | 479.61 D |
65.00€
*
Cytochalasin B
Item number: AG-CN2-0504-M001
White solid. Soluble in DMSO, methanol, ethanol or DMF. Cell permeable mycotoxin, Actin polymerization inhibitor. Binds to the barbed end of actin, reversibly inhibiting the elongation and shortening of actin filaments. Induces nuclear extrusion, By disrupting actin polymerization, blocks diverse cellular functions,...
| Keywords: | Phomin, NSC 107658 |
| Application: | Cell permeable mycotoxin, Actin polymerization inhibitor |
| CAS | 14930-96-2 |
| MW: | 479,6 D |
From 55.00€
*
Cytochalasin B
Item number: LKT-C9879.1
An actin-disrupting agent that blocks activated hKv1.5 channels and endogenous I(K,ur) in a cytoskeleton-independent manner.
| Application: | Actin-disrupting agent |
| CAS | 14930-96-2 |
| MW: | 479.61 D |
From 113.00€
*
