3 products were found matching "14721-66-5"!
No results were found for the filter!
Phytanic acid
Item number: TGM-T73757-10mg
Description: Phytanic acid, an endogenous metabolite found in blood, is utilized in studying Zellweger Syndrome, Alpha Methylacyl CoA Racemase Deficiency, Rhizomelic Chondrodysplasia Punctata, and Infantile Refsum Disease [1] [2] [3] [4] [5]. Target: Others. Smiles: CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)=O
| Application: | Fatty acid metabolite of chlorophyll, RXR and PPAR agonist, potential GPR40 agonist |
| CAS | 14721-66-5 |
| MW: | 312.53 D |
From 233.00€
*
Phytanic Acid
Item number: Cay90360-5
Phytanic acid is a saturated 20-carbon branched-chain fatty acid which can only be derived from dietary sources. In cases of peroxisomal disorders, elevated levels of phytanic acid have been observed, and this is linked to diseases such as infantile phytanic acid storage disease and Refsum's disease.Formal Name:...
| Keywords: | 3,7,11,15-tetramethylhexadecanoic acid |
| Application: | Bioactive lipid assays |
| CAS | 14721-66-5 |
| MW: | 312.5 D |
From 128.00€
*
Phytanic Acid
Item number: LKT-P3198.25
Fatty acid metabolite of chlorophyll, RXR and PPAR agonist, potential GPR40 agonist.
| Keywords: | 3,7,11,15-Tetramethylhexadecanoic acid |
| Application: | Fatty acid metabolite of chlorophyll, RXR and PPAR agonist, potential GPR40 agonist |
| CAS | 14721-66-5 |
| MW: | 312.53 D |
From 374.00€
*
