3 products were found matching "1229208-44-9"!
No results were found for the filter!
Entospletinib
Item number: TGM-T6101-100mg
Description: Entospletinib (GS-9973) (IC50= 7.7 nM)is a specific Syk inhibitor, which is orally bioavailable. Target: Syk. Smiles: C1CN(CCO1)c1ccc(Nc2nc(cn3ccnc23)-c2ccc3cn[nH]c3c2)cc1. References: J Med Chem. 2014, 57(9), 3856-3873.
| Keywords: | GS-9973 |
| Application: | Targets spleen tyrosine kinase [EC:2.7.10.2] (SYK) |
| CAS | 1229208-44-9 |
| MW: | 411.46 D |
From 33.00€
*
GS-9973
Item number: Cay17653-1
Spleen tyrosine kinase (Syk) is a non-receptor tyrosine kinase that upon phosphorylation binds to immunoreceptor tyrosine-based activation motifs of FcRgamma chains and mediates downstream signaling related to platelet function and inflammation. GS-9973 is a potent Syk inhibitor (IC50 = 7.7 nM) that demonstrates...
| Keywords: | 6-(1H-indazol-6-yl)-N-[4-(4-morpholinyl)phenyl]-imidazo[1,2-a]pyrazin-8-amine |
| Application: | Syk inhibitor |
| CAS | 1229208-44-9 |
| MW: | 411.5 D |
From 49.00€
*
GS-9973
Item number: LKT-G7232.1
Syk inhibitor.
| Keywords: | GS9973, Entospletinib |
| Application: | Syk inhibitor |
| CAS | 1229208-44-9 |
| MW: | 411.46 D |
From 156.00€
*
