Z-Lys-OH

Description: Z-Lys-OH is a competitive inhibitor of papain, a lysine derivative. Target: Cysteine Protease. Smiles: [C@H](NC(OCC1=CC=CC=C1)=O)(CCCCN)C(O)=O. References: Recognized as beneficial ergogenic dietary substances, amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, provide fuel during exercise, enhance mental performance during stress-related tasks, and prevent exercise-induced muscle damage[1].