Dehydrolithocholic Acid

Dehydrolithocholic acid is a major metabolite of lithocholic acid (LCA, Cay-20253). It is formed from LCA by the cytochrome P450 (CYP) isoform CYP3A4. Dehydrolithocholic acid is an agonist of G protein-coupled bile acid activated receptor 1 (GP-BAR1/TGR5, EC50 = 0.27 µM), vitamin D receptor (VDR, EC50 = 3 µM), and farnesoid X receptor (FXR) in cell-based reporter assays. It also binds to the human pregnane X receptor (PXR, IC50 = 15 µM) and activates mouse and human PXRs in cell-based reporter assays when used at a concentration of 100 µM. Dehydrolithocholic acid binds to retinoic acid receptor-related orphan receptor gammat (RORgammat, Kd = 1.13 µM for the recombinant human ligand-binding domain) and decreases its activity in a cell-based reporter assay when used at a concentration of 10 µM. It inhibits the differentiation of T helper cells that express IL-17a (TH17 cells) when used at a concentration of 20 µM.Formal Name: (5beta)-3-oxo-cholan-24-oic acid. CAS Number: 1553-56-6. Synonyms: 3-keto LCA, 3-keto Lithocholate, 3-keto Lithocholic Acid, 3-KLCA, 3-oxo LCA, 3-oxo Lithocholate, 3-oxo Lithocholic Acid. Molecular Formula: C24H38O3. Formula Weight: 374.6. Purity: >95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 30 mg/ml, DMF:PBS (pH 7.2) (1:4): 0.20 mg/ml, DMSO: 15 mg/ml, Ethanol: 10 mg/ml. SMILES: C[C@H](CCC(O)=O)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC[C@]4([H])CC(CC[C@]4(C)[C@@]3([H])CC[C@@]21C)=O. InChi Code: InChI=1S/C24H38O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-16,18-21H,4-14H2,1-3H3,(H,26,27)/t15-,16-,18+,19-,20+,21+,23+,24-/m1/s1. InChi Key: KIQFUORWRVZTHT-OPTMKGCMSA-N.