Vitexin

Description: 1. Vitexin has antinociceptive and antispasmodic activities. 2. Vitexin exhibits a prominent first-pass effect. 3. Vitexin has antioxidant, antimyeloperoxidase, and alpha-glucosidase inhibitory activities. 4. Vitexin can either inhibit or induce activities of CYP2C11 and CYP3A1. 5. Vitexin induces the novel p53-dependent metastatic and apoptotic pathway. 6. Vitexin protects brain against cerebral I/R injury, and this effect may be regulated by mitogen-activated protein kinase (MAPK) and apoptosis signaling pathways. Target: Antioxidant. Smiles: OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)c1c(O)cc(O)c2c1oc(cc2=O)-c1ccc(O)cc1. References: Can ÖD1, Demir Özkay Ü, Üçel UI. Anti-depressant-like effect of vitexin in BALB/c mice and evidence for the involvement of monoaminergic mechanisms[J]. European Journal of Pharmacology, 2013, 699(1-3):250-257.