Validamycin A

Description: Validamycin A is an antifungal agent used to protect rice plants against sheath blight caused by the pathogenic fungus, R. solani, due to its ability to inhibit trehalase, a trehalose-hydrolizing enzyme (Ki = 1.9 nM, IC50 = 0.7 µM). It is also effective against the growth and sporulation of R. cerealis, F. culmorum, and other fungi. This compound has also been used to study trehalase activity and trehalose biosynthesis. Target: Others. Smiles: OC[C@H]1C[C@H](N[C@H]2C=C(CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O