URB447

Description: URB447, a peripherally restricted CB1 cannabinoid antagonist with IC50 values of 313 nM for rat CB1 receptor and 41 nM for human CB2 receptor, effectively reduces food intake and body weight gain in mice. It achieves these effects without penetrating the brain or antagonizing central CB1-dependent responses, making it a potential research tool for obesity studies [1]. Target: Others. Smiles: C(N1C(=C(N)C(C(=O)C2=CC=CC=C2)=C1C)C3=CC=CC=C3)C4=CC=C(Cl)C=C4