Salbutamol-d9

Description: Salbutamol-d9 is a deuterated compound of Salbutamol. Salbutamol has a CAS number of 18559-94-9. Albuterol stimulates beta2-adrenergic receptors in the lungs, thereby activating the enzyme adenylate cyclase that catalyzes the conversion of ATP to cyclic-3', 5'-adenosine monophosphate (cAMP). Albuterol Sulfate is the sulfate salt of the short-acting sympathomimetic agent albuterol, a 1:1 racemic mixture of (R)-albuterol and (S)-albuterol with bronchodilator activity. Increased cAMP concentrations relax the bronchial smooth muscle, relieve bronchospasms, and reduce inflammatory cell mediator release, especially from mast cells. To a lesser extent, albuterol stimulates beta1-adrenergic receptors, thereby increasing the force and rate of myocardial contraction. Smiles: C(CNC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])(O)C1=CC(CO)=C(O)C=C1