D-Glucose 6-phosphate sodium

Description: In cells, D-Glucose 6-phosphate sodium (G6P) is generated when glucose is phosphorylated by hexokinase or glucokinase or by the conversion of glucose-1-phosphate by phosphoglucomutase during glycogenolysis. G6P lies at the beginning of both glycolysis and the pentose phosphate pathways. It also can be stored as glycogen when blood glucose levels are high. Target: Endogenous Metabolite, Others. Smiles: [Na+].OC1OC(COP(O)([O-])=O)[C@@H](O)[C@@H](O)C1O. References: Cappellini, M.D., and Fiorelli, G. Glucose-6-phosphate dehydrogenase deficiency. Lancet 371(9606), 64-74 (2008).