Cucurbitacin B

Cucurbitacin B is a plant-derived triterpene that has the classic four-ring structure of mammalian steroids. It has diverse effects on mammalian cells, most notably inducing cell cycle arrest or apoptosis in a range of cancer cell lines. Cucurbitacin B inhibits the growth of several breast cancer cell lines (IC50s = 18-50 nM). It suppresses the growth of tumors developed from MDA-MB-231 and 4T-1 breast cancer cells in mice. Cucurbitacin B blocks the inflammatory response of macrophages treated with lipopolysaccharide. In Drosophila, it serves as an ecdysteroid receptor antagonist (Kd = 5 µM).Formal Name: (2beta,9beta,10alpha,16alpha,23E)-25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-3,11,22-trione. CAS Number: 6199-67-3. Synonyms: NSC 49451, NSC 144154. Molecular Formula: C32H46O8. Formula Weight: 558.7. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: Acetonitrile: Soluble, Dichloromethane: Soluble, Ethyl Acetate: Soluble. lambdamax: 226 nm. SMILES: O[C@@H]1C(C(C)(C)C2=CC[C@]([C@@](C[C@@H](O)[C@]3([H])[C@](O)(C)C(/C=C/C(C)(C)OC(C)=O)=O)(C)[C@]3(C)CC4=O)([H])[C@]4(C)[C@]2([H])C1)=O. InChi Code: InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19-22,25,34-35,39H,11,14-16H2,1-9H3/b13-12+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1. InChi Key: IXQKXEUSCPEQRD-DKRGWESNSA-N. Origin: Plant/Cucumis melo L..