Concanamycin B

Description: Concanamycin B is a macrolide antibiotic that selectively inhibits vacuolar type H+-ATPases (IC50 = 5 nM), thereby blocking vacuolar organelle acidification and early to late endosomal transport. It interferes with bone resorption, maturation of CD8 T lymphocytes, and prevents processing of major histocompatibility complex (MHC) class II precursors in human B cells, inhibiting MHC class II molecule expression on the cell surface. Target: Others. Smiles: [H][C@@]1(C[C@@H](O)[C@H](OC(N)=O)[C@@H](C)O1)O[C@@H]1C[C@@](O)(O[C@H](\C=C\C)[C@H]1C)[C@@H](C)[C@H](O)[C@H](C)[C@@]1([H])OC(=O)\C(OC)=C\C(\C)=C\[C@@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@H](C)C\C(C)=C\C=C\[C@@H]1OC