CAY10561

Description: The extracellular signal-regulated kinase (ERK) signal transduction pathway regulates a diverse array of cellular processes. These processes include cell survival, proliferation, motility, and differentiation and are constitutively activated in cancers involving lung, colon, pancreas, kidney, and ovary. CAY10561 is a potent, ATP-competitive inhibitor of ERK2 (Ki = 2 nM). This compound is highly selective for ERK2 compared to other kinases such as PKA (Ki = 0.39 µM) and JNK3 (Ki = 4 µM). CAY10561 inhibits proliferation of COLO 205 cells with an IC50 value of 0.54 µM. Target: Others. Smiles: C(NC(CO)C1=CC(Cl)=C(F)C=C1)(=O)C2=CC(C=3C(=CNN3)C4=CC(Cl)=CC=C4)=CN2