2-deoxy-D-Ribose

2-deoxy-D-Ribose is a reducing sugar formed as a degradation product during metabolism of thymidine (Cay-20519) by thymidine phosphorylase. It increases levels of reactive oxygen species (ROS) in HL-60 human leukemia cells when used at a concentration of 15 mM. 2-deoxy-D-Ribose (10 µM) induces tubulogenesis and migration of bovine aortic endothelial (BAE) cells. Topical administration of 2-deoxy-D-ribose increases blood vessel formation and accelerates wound healing in a rat full-thickness cutaneous wound model.Formal Name: 2-deoxy-D-erythro-pentose. CAS Number: 533-67-5. Synonyms: 2-Deoxy-D-arabinose, Thyminose, (3S,4R)-3,4,5-Trihydroxypentanal. Molecular Formula: C5H10O4. Formula Weight: 134.1. Purity: >95%. Formulation: (Request formulation change), A solid. Solubility: DMF: 10mg/mL, DMSO: 3mg/mL, Ethanol: 5mg/mL, PBS (pH 7.2): 10mg/mL. SMILES: OC[C@@H](O)[C@@H](O)CC=O. InChi Code: InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5+/m0/s1. InChi Key: ASJSAQIRZKANQN-CRCLSJGQSA-N.