N-3-hydroxyoctanoyl-L-Homoserine lactone

Description: N-3-hydroxyoctanoyl-L-Homoserine lactone, a small diffusible signaling molecule secreted by various bacteria, plays a critical role in quorum sensing-a regulatory system used by bacteria to control gene expression according to cell density changes. This compound is generated via lactonolysis from 3-oxooctanoyl-homoserine lactone and can either activate or suppress gene expression and biofilm formation. Its production and function vary within the bacterial population growth phases, consequently mediating distinct cellular effects through alterations in gene expression, hence contributing to either quorum sensing or quenching. Target: Others. Smiles: CCCCCC(O)CC(=O)N[C@H]1CCOC1=O