Zu "K20731" wurden 169 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-TTR
Artikelnummer: ABS-KC-1812.100
Protein function: Thyroid hormone-binding protein. Probably transports thyroxine from the bloodstream to the brain. [The UniProt Consortium]
| Schlagworte: | Anti-Transthyretin, Anti-ATTR, Anti-Prealbumin, Anti-TBPA, TTR Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse |
ab 206,00 €
TTR (human), recombinant protein
Artikelnummer: ABS-PP-073.20
| Schlagworte: | Transthyretin, ATTR, Prealbumin, TBPA, Recombinant Human TTR Protein |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 13.5 kD |
ab 90,00 €
Anti-TTR
Artikelnummer: ABS-KC-4339.100
Protein function: Thyroid hormone-binding protein. Probably transports thyroxine from the bloodstream to the brain. [The UniProt Consortium]
| Schlagworte: | Anti-Transthyretin, Anti-ATTR, Anti-Prealbumin, Anti-TBPA, TTR Antibody |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 232,00 €
Acoramidis
Artikelnummer: Cay41522-10
Acoramidis is a kinetic stabilizer of transthyretin (TTR). It selectively binds to wild-type TTR and TTRV122I with negative cooperativity (Kd1s = 4.8 and 6.2 nM, respectively, Kd2s = 314 and 139 nM, respectively) over COX-1, COX-2, and the thyroid hormone nuclear receptor (IC50s = >10 µM for all). Acoramidis...
| Schlagworte: | AG-10, 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluoro-benzoic acid |
| Anwendung: | TTR kinetic stabilizer |
| CAS | 1446711-81-4 |
| MW: | 292.3 D |
ab 308,00 €
Acoramidis (hydrochloride)
Artikelnummer: Cay41536-10
Acoramidis is a kinetic stabilizer of transthyretin (TTR). It selectively binds to wild-type TTR and TTRV122I with negative cooperativity (Kd1s = 4.8 and 6.2 nM, respectively, Kd2s = 314 and 139 nM, respectively) over COX-1, COX-2, and the thyroid hormone nuclear receptor (IC50s = >10 µM for all). Acoramidis...
| Schlagworte: | AG-10, 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluoro-benzoic acid, monohydrochloride |
| Anwendung: | TTR kinetic stabilizer |
| CAS | 2242751-53-5 |
| MW: | 328.8 D |
ab 171,00 €
Patisiran sodium
Artikelnummer: TGM-T38804-1mg
Description: Patisiran sodium, a double-stranded small interfering RNA (siRNA), selectively targets a specific sequence within the transthyretin (TTR) messenger RNA (mRNA), effectively blocking hepatic synthesis of both mutant and wild-type TTR. It has significant applications in hereditary TTR amyloidosis research....
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 1386913-72-9 |
ab 826,00 €
Inotersen sodium
Artikelnummer: TGM-T38909-10mg
Description: Inotersen sodium, also known as ISIS-420915 sodium, is a 2'-O-methoxyethyl-modified antisense oligonucleotide compound. It effectively inhibits transthyretin (TTR) protein production by targeting the TTR RNA transcript, thereby reducing TTR transcript levels. Inotersen sodium holds potential for...
| Schlagworte: | ISIS-420915 sodium |
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 1432726-13-0 |
ab 1.549,00 €
Vutrisiran
Artikelnummer: TGM-T39304-25mg
Description: Vutrisiran (ALN-TTRsc02) is an investigational, liver-directed small interfering ribonucleic acid (siRNA) compound designed for research on transthyretin (TTR)-mediated amyloidosis. Target: Others. References: Bahru A Habtemariam, et al. Single-Dose Pharmacokinetics and Pharmacodynamics of Transthyretin...
| Schlagworte: | ALN-TTRsc02 |
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 1867157-35-4 |
1.520,00 €
Acoramidis hydrochloride
Artikelnummer: TGM-T39740-100mg
Description: Acoramidis hydrochloride (Alxn2060 hydrochloride) is an orally active and selective kinetic stabilizer of WT and V122I- TTR (transthyretin) . Acoramidis hydrochloride is used in the study for transthyretin amyloidosis. Target: Others. Smiles: Cl.Cc1n[nH]c(C)c1CCCOc1cc(ccc1F)C(O)=O. References: Sravan C...
| Schlagworte: | AG10 hydrochloride, Alxn2060 hydrochloride |
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 2242751-53-5 |
| MW: | 328.77 D |
ab 58,00 €
Tafamidis
Artikelnummer: TGM-T4565-100mg
Description: Tafamidis (Fx-1006A) is a kinetic stabilizer of transthyretin (TTR) that prevents amyloidogenesis by wild-type and mutant TTRs. It binds to TTR with negative cooperativity (Kd1: 3 nM, Kd2: 278 nM) to stabilize the TTR dimer-dimer interface and inhibit tetrameric dissociation. Tafamidis stabilizes...
| Schlagworte: | Fx-1006A |
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 594839-88-0 |
| MW: | 308.12 D |
ab 52,00 €
WT-TTR inhibitor 1
Artikelnummer: TGM-T75173-2mg
Description: Compound 21, a WT-TTR (wild-type Transthyretin) inhibitor, exhibits a 29.05% inhibition rate at a concentration of 100 µM [1]. Target: Others. Smiles: Clc1ccccc1C=c1sc2nc3ccccc3n2c1=O , w:7.7,
| Anwendung: | WT-TTR (wild-type Transthyretin) inhibitor |
| CAS | 23983-05-3 |
| MW: | 312.77 D |
65,00 €
tafamidis meglumine
Artikelnummer: TGM-T7582-100mg
Description: Tafamidis meglumine (Fx-1006A) is a potent and selective transthyretin kinetic stabilizer that inhibits the amyloid cascade. Target: Others. Smiles: CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC(=O)c1ccc2nc(oc2c1)-c1cc(Cl)cc(Cl)c1. References: Bulawa C E , Connelly S , Devit M , et al. Tafamidis, a potent...
| Schlagworte: | Fx-1006A |
| Anwendung: | Targets transthyretin (TTR) |
| CAS | 951395-08-7 |
| MW: | 503.33 D |
ab 37,00 €