Zu "K18964" wurden 34 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ropidoxuridine
Artikelnummer: Cay41220-10
Ropidoxuridine is a radiosensitizer and a prodrug form of the antiviral compound idoxuridine (Cay-20222). It also inhibits viral plaque formation in HeLa cells infected by herpes simplex virus 1 (HSV-1) or HSV-2 when used at a concentration of 100 µM. Ropidoxuridine (1,000 mg/kg per day for six days) enhances...
| Schlagworte: | 5-Iodo-2-pyrimidinone-2'-deoxyribose, IPdR, 1-(2-deoxy-beta-D-erythro-pentofuranosyl)-5-iodo-2(1H)-pyrimidinone |
| Anwendung: | Idoxuridine prodrug, radiosensitizer |
| CAS | 93265-81-7 |
| MW: | 338.1 D |
ab 272,00 €
Cyclopropavir
Artikelnummer: TGM-T15028-100mg
Description: Cyclopropavir (Filociclovir, MBX-400) is a compound of broad-spectrum anti-herpesvirus. It has good antiviral activity against cytomegalovirus (CMV), herpes simplex virus (HHV)-6 and HHV-8 (EC50s: 0.7 µM to 8 µM). Target: Others. Smiles: C(O)C1(CO)/C(=C\N2C3=C(N=C2)C(=O)N=C(N)N3)/C1. References: Kern...
| Schlagworte: | Filociclovir, ZSM-I-62, MBX-400 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 632325-71-4 |
| MW: | 263.25 D |
ab 1.971,00 €
Penciclovir
Artikelnummer: TGM-T1643-100mg
Description: Penciclovir (BRL 39123) is a Herpesvirus Nucleoside Analog DNA Polymerase Inhibitor. In HSV infected cells, penciclovir is phosphorylated by viral thymidine kinase and subsequently converted by cellular kinases into the active metabolite, penciclovir triphosphate, which competitively inhibits viral HSV...
| Schlagworte: | BRL 39123, VSA 671 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 39809-25-1 |
| MW: | 253.26 D |
ab 30,00 €
Famciclovir
Artikelnummer: TGM-T1646-100mg
Description: Famciclovir (BRL 42810) is a Herpes Simplex Virus Nucleoside Analog DNA Polymerase Inhibitor. The mechanism of action of famciclovir is as a DNA Polymerase Inhibitor, and DNA Polymerase Inhibitor. Target: DNA/RNA Synthesis, HSV. Smiles: CC(=O)OCC(CCN1C=NC2=C1N=C(N)N=C2)COC(C)=O. References:...
| Schlagworte: | BRL 42810 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 104227-87-4 |
| MW: | 321.33 D |
ab 31,00 €
Acyclovir
Artikelnummer: TGM-T1454-100mg
Description: Acyclovir (Aciclovir) is a synthetic analog of the purine nucleoside, guanosine, with potent antiviral activity against herpes simplex viruses type 1 and 2, varicella-zoster virus and other viruses of the herpesvirus family. Target: HSV, Antibacterial, Apoptosis, DNA/RNA Synthesis, Antibiotic....
| Schlagworte: | Acycloguanosine, Aciclovir |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 59277-89-3 |
| MW: | 225.2 D |
ab 40,00 €
Acyclovir sodium
Artikelnummer: TGM-T1454L-100mg
Description: Acyclovir sodium is an antimetabolite. Acyclovir sodium inhibits HSV-specified DNA polymerases and prevents further viral DNA synthesis. Target: Others. Smiles: [Na+].Nc1nc([O-])c2ncn(COCCO)c2n1. References: Caviness AC, Demmler GJ, Swint JM, Cantor SB. Cost-effectiveness analysis of herpes simplex...
| Schlagworte: | Aciclovir sodium |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 69657-51-8 |
| MW: | 248.19 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Vidarabine
Artikelnummer: TGM-T1506-100mg
Description: Vidarabine (Adenine Arabinoside) is a nucleoside antibiotic isolated from Streptomyces antibioticus. It has some antineoplastic properties and has broad spectrum activity against DNA viruses in cell cultures and significant antiviral activity against infections caused by a variety of viruses such as the...
| Schlagworte: | Vira-A, Arabinosyladenine, Ara-A, 9-beta-D-Arabinofuranosyladenine, Adenine Arabinoside |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 5536-17-4 |
| MW: | 267.24 D |
ab 40,00 €
Fiacitabine
Artikelnummer: TGM-T15280-100mg
Description: Fiacitabine (NSC-382097) is a selective inhibitor of DNA replication of the herpes simplex virus(HSV) (IC50: 2.5 nM and 12.6 nM for HSV1 and HSV2, respectively). Target: HSV. Smiles: Nc1nc(=O)n(cc1I)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1F. References: Allaudeen HS, et al. Selective inhibition of DNA...
| Schlagworte: | FOAC, FIAC, NSC 382097 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 69123-90-6 |
| MW: | 371.1 D |
ab 161,00 €
Valganciclovir hydrochloride
Artikelnummer: TGM-T1533-100mg
Description: Valganciclovir hydrochloride (Valganciclovir HCl) is a hydrochloride salt form of valganciclovir, a prodrug form of ganciclovir, a nucleoside analog of 2'-deoxyguanosine, with antiviral activity. After phosphorylation, valganciclovir is incorporated into DNA, resulting in inhibition of viral DNA...
| Schlagworte: | Valcyt, Valcyte, Valganciclovir HCl |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 175865-59-5 |
| MW: | 390.82 D |
ab 31,00 €
Sorivudine
Artikelnummer: TGM-T16911-10mg
Description: Sorivudine (BV-araU) has antiviral activity against several viruses including varicella zoster virus, herpes simplex type 1 virus, and Epstein-Barr virus by interfering with viral DNA synthesis. Target: DNA/RNA Synthesis. Smiles: OC[C@H]1O[C@H]([C@@H](O)[C@@H]1O)n1cc(\C=C\Br)c(=O)[nH]c1=O. References:...
| Schlagworte: | BV-araU |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 77181-69-2 |
| MW: | 349.13 D |
ab 55,00 €
Valomaciclovir stearate
Artikelnummer: TGM-T29093-100mg
Description: Valomaciclovir stearate is a DNA polymerase inhibitor. Valomaciclovir stearate is an orally available drug with broad-spectrum antiviral activity against a variety of important herpesviruses, including Epstein-Barr virus, or EBV (the first virus to be directly associated with human cancer), varicella...
| Schlagworte: | EPB-348, ABT-606, MIV-606, A-174606.0, RP-606 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 195156-77-5 |
| MW: | 618.85 D |
ab 1.971,00 €
Omaciclovir
Artikelnummer: TGM-T28234-100mg
Description: Omaciclovir is a DNA-directed DNA polymerase inhibitor. Target: Others. Smiles: Nc1nc2n(C[C@H](CO)CCO)cnc2c(=O)[nH]1. References: Bonnafous P, Agut H. Activity of H2G on human herpesvirus-6B strains either sensitive or resistant to ganciclovir. J Clin Virol. 2010 Jun,48(2):153-4. doi:...
| Schlagworte: | H2G, ABT091, (-)-2HM-HBG, ABT 091, ABT-091, H 2G |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 124265-89-0 |
| MW: | 253.26 D |
ab 1.270,00 €